dwweb-pc/公共/通用前端工作流/js/jquery.nicescroll.js

/* jquery.nicescroll
-- version 3.6.8
-- copyright 2016-02-29 InuYaksa*2016
-- licensed under the MIT
--
-- http://nicescroll.areaaperta.com/
-- https://github.com/inuyaksa/jquery.nicescroll
--
*/

define('nicescroll', function(require, exports, module) {

var $ = require('jquery');

(function(factory) {
  if (typeof define === 'function' && define.amd) {
    // AMD. Register as anonymous module.
    define(['jquery'], factory);
  } else if (typeof exports === 'object') {
    // Node/CommonJS.
    module.exports = factory(require('jquery'));
  } else {
    // Browser globals.
    factory(jQuery);
  }
}(function(jQuery) {
  "use strict";

  // globals
  var domfocus = false;
  var mousefocus = false;
  var tabindexcounter = 0;
  var ascrailcounter = 2000;
  var globalmaxzindex = 0;

  var $ = jQuery; // sandbox

  // http://stackoverflow.com/questions/2161159/get-script-path
  function getScriptPath() {
    var scripts = document.getElementsByTagName('script');
    var path = scripts.length ? scripts[scripts.length - 1].src.split('?')[0] : '';
    return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : '';
  }

  var vendors = ['webkit','ms','moz','o'];

  var setAnimationFrame = window.requestAnimationFrame || false;
  var clearAnimationFrame = window.cancelAnimationFrame || false;

  if (!setAnimationFrame) {  // legacy detection
    for (var vx in vendors) {
      var v = vendors[vx];
      setAnimationFrame = window[v + 'RequestAnimationFrame'];
      if (setAnimationFrame) {
        clearAnimationFrame = window[v + 'CancelAnimationFrame'] || window[v + 'CancelRequestAnimationFrame'];
        break;
      }
    }
  }

  var ClsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false;

  var _globaloptions = {
    zindex: "auto",
    cursoropacitymin: 0,
    cursoropacitymax: 1,
    cursorcolor: "#424242",
    cursorwidth: "6px",
    cursorborder: "1px solid #fff",
    cursorborderradius: "5px",
    scrollspeed: 60,
    mousescrollstep: 8 * 3,
    touchbehavior: false,
    hwacceleration: true,
    usetransition: true,
    boxzoom: false,
    dblclickzoom: true,
    gesturezoom: true,
    grabcursorenabled: true,
    autohidemode: true,
    background: "",
    iframeautoresize: true,
    cursorminheight: 32,
    preservenativescrolling: true,
    railoffset: false,
    railhoffset: false,
    bouncescroll: true,
    spacebarenabled: true,
    railpadding: {
      top: 0,
      right: 0,
      left: 0,
      bottom: 0
    },
    disableoutline: true,
    horizrailenabled: true,
    railalign: "right",
    railvalign: "bottom",
    enabletranslate3d: true,
    enablemousewheel: true,
    enablekeyboard: true,
    smoothscroll: true,
    sensitiverail: true,
    enablemouselockapi: true,
    //      cursormaxheight:false,
    cursorfixedheight: false,
    directionlockdeadzone: 6,
    hidecursordelay: 400,
    nativeparentscrolling: true,
    enablescrollonselection: true,
    overflowx: true,
    overflowy: true,
    cursordragspeed: 0.3,
    rtlmode: "auto",
    cursordragontouch: false,
    oneaxismousemode: "auto",
    scriptpath: getScriptPath(),
    preventmultitouchscrolling: true,
    disablemutationobserver:false
  };

  var browserdetected = false;

  var getBrowserDetection = function() {

    if (browserdetected) return browserdetected;

    var _el = document.createElement('DIV'),
        _style = _el.style,
        _agent = navigator.userAgent,
        _platform = navigator.platform,
        d = {};

    d.haspointerlock = "pointerLockElement" in document || "webkitPointerLockElement" in document || "mozPointerLockElement" in document;

    d.isopera = ("opera" in window); // 12-
    d.isopera12 = (d.isopera && ("getUserMedia" in navigator));
    d.isoperamini = (Object.prototype.toString.call(window.operamini) === "[object OperaMini]");

    d.isie = (("all" in document) && ("attachEvent" in _el) && !d.isopera); //IE10-
    d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older
    d.isie7 = d.isie && !d.isieold && (!("documentMode" in document) || (document.documentMode == 7));
    d.isie8 = d.isie && ("documentMode" in document) && (document.documentMode == 8);
    d.isie9 = d.isie && ("performance" in window) && (document.documentMode == 9);
    d.isie10 = d.isie && ("performance" in window) && (document.documentMode == 10);
    d.isie11 = ("msRequestFullscreen" in _el) && (document.documentMode >= 11); // IE11+
    d.isieedge12 = (navigator.userAgent.match(/Edge\/12\./));  // IE Edge 12
    d.isieedge = ("msOverflowStyle" in _el);  // IE Edge
    d.ismodernie = d.isie11 || d.isieedge;
    
    d.isie9mobile = /iemobile.9/i.test(_agent); //wp 7.1 mango
    if (d.isie9mobile) d.isie9 = false;
    d.isie7mobile = (!d.isie9mobile && d.isie7) && /iemobile/i.test(_agent); //wp 7.0

    d.ismozilla = ("MozAppearance" in _style);

    d.iswebkit = ("WebkitAppearance" in _style);

    d.ischrome = ("chrome" in window);
    d.ischrome38 = (d.ischrome && ("touchAction" in _style)); // behavior changed in touch emulation    
    d.ischrome22 = (!d.ischrome38)&&(d.ischrome && d.haspointerlock);
    d.ischrome26 = (!d.ischrome38)&&(d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix)
    
    d.cantouch = ("ontouchstart" in document.documentElement) || ("ontouchstart" in window); // with detection for Chrome Touch Emulation    
    d.hasw3ctouch = (window.PointerEvent || false) && ((navigator.MaxTouchPoints > 0)||(navigator.msMaxTouchPoints > 0)); //IE11 pointer events, following W3C Pointer Events spec
    d.hasmstouch = (!d.hasw3ctouch)&&(window.MSPointerEvent || false); // IE10 pointer events

    d.ismac = /^mac$/i.test(_platform);
    
    d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(_platform));
    d.isios4 = ((d.isios) && !("seal" in Object));
    d.isios7 = ((d.isios)&&("webkitHidden" in document));  //iOS 7+
    d.isios8 = ((d.isios)&&("hidden" in document));  //iOS 8+

    d.isandroid = (/android/i.test(_agent));

    d.haseventlistener = ("addEventListener" in _el);
    
    d.trstyle = false;
    d.hastransform = false;
    d.hastranslate3d = false;
    d.transitionstyle = false;
    d.hastransition = false;
    d.transitionend = false;

    var a;
    var check = ['transform', 'msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];    
    for (a = 0; a < check.length; a++) {
      if (_style[check[a]] !== undefined) {
        d.trstyle = check[a];
        break;
      }
    }
    d.hastransform = (!!d.trstyle);
    if (d.hastransform) {
      _style[d.trstyle] = "translate3d(1px,2px,3px)";
      d.hastranslate3d = /translate3d/.test(_style[d.trstyle]);
    }

    d.transitionstyle = false;
    d.prefixstyle = '';
    d.transitionend = false;
    check = ['transition', 'webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
    var prefix = ['', '-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
    var evs = ['transitionend', 'webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
    for (a = 0; a < check.length; a++) {
      if (check[a] in _style) {
        d.transitionstyle = check[a];
        d.prefixstyle = prefix[a];
        d.transitionend = evs[a];
        break;
      }
    }
    if (d.ischrome26) {  // always use prefix
      d.prefixstyle = prefix[1];
    }

    d.hastransition = (d.transitionstyle);

    function detectCursorGrab() {
      var lst = ['grab','-webkit-grab', '-moz-grab'];
      if ((d.ischrome && !d.ischrome38) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug
      for (var a = 0; a < lst.length; a++) {
        var p = lst[a];
        _style.cursor = p;
        if (_style.cursor == p) return p;
      }
      return 'url(//patriciaportfolio.googlecode.com/files/openhand.cur),n-resize'; // thank you google for custom cursor!
    }
    d.cursorgrabvalue = detectCursorGrab();

    d.hasmousecapture = ("setCapture" in _el);

    d.hasMutationObserver = (ClsMutationObserver !== false);

    _el = null; //memory released

    browserdetected = d;

    return d;
  };

  var NiceScrollClass = function(myopt, me) {

    var self = this;

    this.version = '3.6.8';
    this.name = 'nicescroll';

    this.me = me;

    this.opt = {
      doc: $("body"),
      win: false
    };

    $.extend(this.opt, _globaloptions);  // clone opts

    // Options for internal use
    this.opt.snapbackspeed = 80;

    if (myopt || false) {
      for (var a in self.opt) {
        if (myopt[a] !== undefined) self.opt[a] = myopt[a];
      }
    }

    if (self.opt.disablemutationobserver) ClsMutationObserver = false;
    
    this.doc = self.opt.doc;
    this.iddoc = (this.doc && this.doc[0]) ? this.doc[0].id || '' : '';
    this.ispage = /^BODY|HTML/.test((self.opt.win) ? self.opt.win[0].nodeName : this.doc[0].nodeName);
    this.haswrapper = (self.opt.win !== false);
    this.win = self.opt.win || (this.ispage ? $(window) : this.doc);
    this.docscroll = (this.ispage && !this.haswrapper) ? $(window) : this.win;
    this.body = $("body");
    this.viewport = false;

    this.isfixed = false;

    this.iframe = false;
    this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME'));

    this.istextarea = (this.win[0].nodeName == 'TEXTAREA');

    this.forcescreen = false; //force to use screen position on events

    this.canshowonmouseevent = (self.opt.autohidemode != "scroll");

    // Events jump table    
    this.onmousedown = false;
    this.onmouseup = false;
    this.onmousemove = false;
    this.onmousewheel = false;
    this.onkeypress = false;
    this.ongesturezoom = false;
    this.onclick = false;

    // Nicescroll custom events
    this.onscrollstart = false;
    this.onscrollend = false;
    this.onscrollcancel = false;

    this.onzoomin = false;
    this.onzoomout = false;

    // Let's start!  
    this.view = false;
    this.page = false;

    this.scroll = {
      x: 0,
      y: 0
    };
    this.scrollratio = {
      x: 0,
      y: 0
    };
    this.cursorheight = 20;
    this.scrollvaluemax = 0;

    // http://dev.w3.org/csswg/css-writing-modes-3/#logical-to-physical
    // http://dev.w3.org/csswg/css-writing-modes-3/#svg-writing-mode
    if (this.opt.rtlmode == "auto") {
      var target = this.win[0] == window ? this.body : this.win;
      var writingMode = target.css("writing-mode") || target.css("-webkit-writing-mode") || target.css("-ms-writing-mode") || target.css("-moz-writing-mode");

      if (writingMode == "horizontal-tb" || writingMode == "lr-tb" || writingMode == "") {
        this.isrtlmode = (target.css("direction") == "rtl");
        this.isvertical = false;
      } else {
        this.isrtlmode = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl" || writingMode == "rl-tb");
        this.isvertical = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl");
      }
    } else {
      this.isrtlmode = (this.opt.rtlmode === true);
      this.isvertical = false;
    }
    //    this.checkrtlmode = false;
    
    this.scrollrunning = false;

    this.scrollmom = false;

    this.observer        = false;  // observer div changes
    this.observerremover = false;  // observer on parent for remove detection
    this.observerbody    = false;  // observer on body for position change

    do {
      this.id = "ascrail" + (ascrailcounter++);
    } while (document.getElementById(this.id));

    this.rail = false;
    this.cursor = false;
    this.cursorfreezed = false;
    this.selectiondrag = false;

    this.zoom = false;
    this.zoomactive = false;

    this.hasfocus = false;
    this.hasmousefocus = false;

    this.visibility = true;
    this.railslocked = false;  // locked by resize
    this.locked = false;  // prevent lost of locked status sets by user
    this.hidden = false; // rails always hidden
    this.cursoractive = true; // user can interact with cursors

    this.wheelprevented = false; //prevent mousewheel event

    this.overflowx = self.opt.overflowx;
    this.overflowy = self.opt.overflowy;

    this.nativescrollingarea = false;
    this.checkarea = 0;

    this.events = []; // event list for unbind

    this.saved = {};  // style saved

    this.delaylist = {};
    this.synclist = {};

    this.lastdeltax = 0;
    this.lastdeltay = 0;

    this.detected = getBrowserDetection();

    var cap = $.extend({}, this.detected);

    this.canhwscroll = (cap.hastransform && self.opt.hwacceleration);
    this.ishwscroll = (this.canhwscroll && self.haswrapper);

    if (!this.isrtlmode) {
      this.hasreversehr = false;
    } else if (this.isvertical) { // RTL mode with reverse horizontal axis
      this.hasreversehr = !(cap.iswebkit || cap.isie || cap.isie11);
    } else {
      this.hasreversehr = !(cap.iswebkit || (cap.isie && !cap.isie10 && !cap.isie11));
    }

    this.istouchcapable = false; // desktop devices with touch screen support

    //## Check WebKit-based desktop with touch support
    //## + Firefox 18 nightly build (desktop) false positive (or desktop with touch support)
    
    if (!cap.cantouch && (cap.hasw3ctouch||cap.hasmstouch)) {  // desktop device with multiple input
      this.istouchcapable = true;
    } else if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) {
      this.istouchcapable = true;
//      cap.cantouch = false; // parse normal desktop events
    }

    //## disable MouseLock API on user request
    if (!self.opt.enablemouselockapi) {
      cap.hasmousecapture = false;
      cap.haspointerlock = false;
    }

/* deprecated
    this.delayed = function(name, fn, tm, lazy) {
    };
*/    

/*
    this.debounced = function(name, fn, tm) {
		if (!self) return;
      var dd = self.delaylist[name];
      self.delaylist[name] = fn;
      if (!dd) {
        self.debouncedelayed =  setTimeout(function() {
					if (!self) return;
          var fn = self.delaylist[name];
          self.delaylist[name] = false;
          fn.call(self);
        }, tm);
      }
    };
*/

		this.debounced = function(name, fn, tm) {
      if (!self) return;
			var dd = self.delaylist[name]||false;
			if (!dd) {
				fn.call(self);				
				self.delaylist[name] = {
					h: setAnimationFrame(function(){
						self.delaylist[name].fn.call(self);
					  self.delaylist[name] = false;	
					}, tm)
				};				
			}			
			self.delaylist[name].fn = fn;				
		};

    var _onsync = false;

    this.synched = function(name, fn) {

      function requestSync() {
        if (_onsync) return;
        setAnimationFrame(function() {
          if (!self) return;
          _onsync = false;
          for (var nn in self.synclist) {
            var fn = self.synclist[nn];
            if (fn) fn.call(self);
            self.synclist[nn] = false;
          }
        });
        _onsync = true;
      }

      self.synclist[name] = fn;
      requestSync();
      return name;
    };

    this.unsynched = function(name) {
      if (self.synclist[name]) self.synclist[name] = false;
    };

    this.css = function(el, pars) { // save & set
      for (var n in pars) {
        self.saved.css.push([el, n, el.css(n)]);
        el.css(n, pars[n]);
      }
    };

    this.scrollTop = function(val) {
      return (val === undefined) ? self.getScrollTop() : self.setScrollTop(val);
    };

    this.scrollLeft = function(val) {
      return (val === undefined) ? self.getScrollLeft() : self.setScrollLeft(val);
    };

    // derived by by Dan Pupius www.pupius.net
    var BezierClass = function(st, ed, spd, p1, p2, p3, p4) {
    
      this.st = st;
      this.ed = ed;
      this.spd = spd;

      this.p1 = p1 || 0;
      this.p2 = p2 || 1;
      this.p3 = p3 || 0;
      this.p4 = p4 || 1;

      this.ts = (new Date()).getTime();
      this.df = this.ed - this.st;
    };
    BezierClass.prototype = {
      B2: function(t) {
        return 3 * t * t * (1 - t);
      },
      B3: function(t) {
        return 3 * t * (1 - t) * (1 - t);
      },
      B4: function(t) {
        return (1 - t) * (1 - t) * (1 - t);
      },
      getNow: function() {
        var nw = (new Date()).getTime();
        var pc = 1 - ((nw - this.ts) / this.spd);
        var bz = this.B2(pc) + this.B3(pc) + this.B4(pc);
        return (pc < 0) ? this.ed : this.st + Math.round(this.df * bz);
      },
      update: function(ed, spd) {
        this.st = this.getNow();
        this.ed = ed;
        this.spd = spd;
        this.ts = (new Date()).getTime();
        this.df = this.ed - this.st;
        return this;
      }
    };

    //derived from http://stackoverflow.com/questions/11236090/
    function getMatrixValues() {
      var tr = self.doc.css(cap.trstyle);
      if (tr && (tr.substr(0, 6) == "matrix")) {
        return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g, '').split(/, +/);
      }
      return false;
    }

    if (this.ishwscroll) {
      // hw accelerated scroll
      this.doc.translate = {
        x: 0,
        y: 0,
        tx: "0px",
        ty: "0px"
      };

      //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/
      if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/      

      this.getScrollTop = function(last) {
        if (!last) {
          var mtx = getMatrixValues();
          if (mtx) return (mtx.length == 16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10
          if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow();
        }
        return self.doc.translate.y;
      };

      this.getScrollLeft = function(last) {
        if (!last) {
          var mtx = getMatrixValues();
          if (mtx) return (mtx.length == 16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10
          if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow();
        }
        return self.doc.translate.x;
      };

      this.notifyScrollEvent = function(el) {
        var e = document.createEvent("UIEvents");
        e.initUIEvent("scroll", false, true, window, 1);
        e.niceevent = true;
        el.dispatchEvent(e);
      };

      var cxscrollleft = (this.isrtlmode) ? 1 : -1;

      if (cap.hastranslate3d && self.opt.enabletranslate3d) {
        this.setScrollTop = function(val, silent) {
          self.doc.translate.y = val;
          self.doc.translate.ty = (val * -1) + "px";
          self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
          if (!silent) self.notifyScrollEvent(self.win[0]);
        };
        this.setScrollLeft = function(val, silent) {
          self.doc.translate.x = val;
          self.doc.translate.tx = (val * cxscrollleft) + "px";
          self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
          if (!silent) self.notifyScrollEvent(self.win[0]);
        };
      } else {
        this.setScrollTop = function(val, silent) {
          self.doc.translate.y = val;
          self.doc.translate.ty = (val * -1) + "px";
          self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
          if (!silent) self.notifyScrollEvent(self.win[0]);
        };
        this.setScrollLeft = function(val, silent) {
          self.doc.translate.x = val;
          self.doc.translate.tx = (val * cxscrollleft) + "px";
          self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
          if (!silent) self.notifyScrollEvent(self.win[0]);
        };
      }
    } else {
      // native scroll
      this.getScrollTop = function() {
        return self.docscroll.scrollTop();
      };
      this.setScrollTop = function(val) {
        return setTimeout(function() {(self)&&self.docscroll.scrollTop(val)}, 1);
      };
      this.getScrollLeft = function() {
        var val;
        if (!self.hasreversehr) {
          val = self.docscroll.scrollLeft();
        } else if (self.detected.ismozilla) {
          val = self.page.maxw - Math.abs(self.docscroll.scrollLeft());
        } else {
          val = self.page.maxw - self.docscroll.scrollLeft();
        }
        return val;
      };
      this.setScrollLeft = function(val) {
        return setTimeout(function() {
          if (!self) return;
					if (self.hasreversehr) {
						if (self.detected.ismozilla) {
							val = -(self.page.maxw - val);
						} else {
							val = self.page.maxw - val;
						}
					}
					return self.docscroll.scrollLeft(val);
				}, 1);					
      };
    }

    this.getTarget = function(e) {
      if (!e) return false;
      if (e.target) return e.target;
      if (e.srcElement) return e.srcElement;
      return false;
    };

    this.hasParent = function(e, id) {
      if (!e) return false;
      var el = e.target || e.srcElement || e || false;
      while (el && el.id != id) {
        el = el.parentNode || false;
      }
      return (el !== false);
    };

    function getZIndex() {
      var dom = self.win;
      if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available
      while (dom.length > 0) {
        if (dom[0].nodeType == 9) return false;
        var zi = dom.css('zIndex');
        if (!isNaN(zi) && zi != 0) return parseInt(zi);
        dom = dom.parent();
      }
      return false;
    }

    //inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie
    var _convertBorderWidth = {
      "thin": 1,
      "medium": 3,
      "thick": 5
    };

    function getWidthToPixel(dom, prop, chkheight) {
      var wd = dom.css(prop);
      var px = parseFloat(wd);
      if (isNaN(px)) {
        px = _convertBorderWidth[wd] || 0;
        var brd = (px == 3) ? ((chkheight) ? (self.win.outerHeight() - self.win.innerHeight()) : (self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS
        if (self.isie8 && px) px += 1;
        return (brd) ? px : 0;
      }
      return px;
    }

    this.getDocumentScrollOffset = function() {
      return {
        top: window.pageYOffset || document.documentElement.scrollTop,
        left: window.pageXOffset || document.documentElement.scrollLeft
      };
    };
    
    this.getOffset = function() {
      if (self.isfixed) {
        var ofs = self.win.offset();  // fix Chrome auto issue (when right/bottom props only)
        var scrl = self.getDocumentScrollOffset();
        ofs.top-=scrl.top;
        ofs.left-=scrl.left;
        return ofs;  
      }
      var ww = self.win.offset();
      if (!self.viewport) return ww;      
      var vp = self.viewport.offset();
      return {
        top: ww.top - vp.top,// + self.viewport.scrollTop(),
        left: ww.left - vp.left // + self.viewport.scrollLeft()
      };
    };

    this.updateScrollBar = function(len) {
      var pos, off;
      if (self.ishwscroll) {
        self.rail.css({  //**
          height: self.win.innerHeight() - (self.opt.railpadding.top + self.opt.railpadding.bottom)
        });
        if (self.railh) self.railh.css({  //**
          width: self.win.innerWidth() - (self.opt.railpadding.left + self.opt.railpadding.right)
        });
        
      } else {
        var wpos = self.getOffset();
        pos = {
          top: wpos.top,
          left: wpos.left - (self.opt.railpadding.left + self.opt.railpadding.right)
        };
        pos.top += getWidthToPixel(self.win, 'border-top-width', true);
        pos.left += (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win, 'border-right-width') - self.rail.width : getWidthToPixel(self.win, 'border-left-width');

        off = self.opt.railoffset;
        if (off) {
          if (off.top) pos.top += off.top;
          if (off.left) pos.left += off.left;
        }
        
        if (!self.railslocked) self.rail.css({
          top: pos.top,
          left: pos.left,
          height: ((len) ? len.h : self.win.innerHeight()) - (self.opt.railpadding.top + self.opt.railpadding.bottom)
        });

        if (self.zoom) {
          self.zoom.css({
            top: pos.top + 1,
            left: (self.rail.align == 1) ? pos.left - 20 : pos.left + self.rail.width + 4
          });
        }

        if (self.railh && !self.railslocked) {
          pos = {
            top: wpos.top,
            left: wpos.left
          };
          off = self.opt.railhoffset;
          if (off) {
            if (off.top) pos.top += off.top;
            if (off.left) pos.left += off.left;
          }
          var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win, 'border-top-width', true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, 'border-top-width', true);
          var x = pos.left + getWidthToPixel(self.win, 'border-left-width');
          self.railh.css({
            top: y - (self.opt.railpadding.top + self.opt.railpadding.bottom),
            left: x,
            width: self.railh.width
          });
        }

      }
    };

    this.doRailClick = function(e, dbl, hr) {
      var fn, pg, cur, pos;

      if (self.railslocked) return;
      self.cancelEvent(e);

      if (dbl) {
        fn = (hr) ? self.doScrollLeft : self.doScrollTop;
        cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth / 2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight / 2)) * self.scrollratio.y);
        fn(cur);
      } else {
        fn = (hr) ? self.doScrollLeftBy : self.doScrollBy;
        cur = (hr) ? self.scroll.x : self.scroll.y;
        pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;
        pg = (hr) ? self.view.w : self.view.h;
        fn((cur >= pos) ? pg: -pg);//   (cur >= pos) ? fn(pg): fn(-pg);
      }

    };

    self.hasanimationframe = (setAnimationFrame);
    self.hascancelanimationframe = (clearAnimationFrame);

    if (!self.hasanimationframe) {
      setAnimationFrame = function(fn) {
        return setTimeout(fn, 15 - Math.floor((+new Date()) / 1000) % 16);
      }; // 1000/60)};
      clearAnimationFrame = clearTimeout;
    } else if (!self.hascancelanimationframe) clearAnimationFrame = function() {
      self.cancelAnimationFrame = true;
    };

    this.init = function() {
    
      self.saved.css = [];
      
      if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!
      if (cap.isoperamini) return true; // SORRY, DO NOT WORK!

      var _touchaction = (cap.isie10) ? '-ms-touch-action' : 'touch-action';
      if (cap.hasmstouch) self.css((self.ispage) ? $("html") : self.win, {
        _touchaction: 'none'
      });

      var _scrollyhidden =  (cap.ismodernie||cap.isie10) ? {'-ms-overflow-style':'none'} : {'overflow-y':'hidden'};  // IE is always a world apart!
      
      self.zindex = "auto";
      if (!self.ispage && self.opt.zindex == "auto") {
        self.zindex = getZIndex() || "auto";
      } else {
        self.zindex = self.opt.zindex;
      }

      if (!self.ispage && self.zindex != "auto" && self.zindex > globalmaxzindex) {
        globalmaxzindex = self.zindex;
      }

      if (self.isie && self.zindex == 0 && self.opt.zindex == "auto") { // fix IE auto == 0
        self.zindex = "auto";
      }

      if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) {

        var cont = self.docscroll;
        if (self.ispage) cont = (self.haswrapper) ? self.win : self.doc;

        if (!cap.isie9mobile) self.css(cont, _scrollyhidden);

        if (self.ispage && cap.isie7) {
          if (self.doc[0].nodeName == 'BODY') self.css($("html"), {
            'overflow-y': 'hidden'
          }); //IE7 double scrollbar issue
          else if (self.doc[0].nodeName == 'HTML') self.css($("body"), _scrollyhidden); //IE7 double scrollbar issue
        }

        if (cap.isios && !self.ispage && !self.haswrapper) self.css($("body"), {
          "-webkit-overflow-scrolling": "touch"
        }); //force hw acceleration

        var cursor = $(document.createElement('div'));
        cursor.css({
          position: "relative",
          top: 0,
          "float": "right",
          width: self.opt.cursorwidth,
          height: 0,
          'background-color': self.opt.cursorcolor,
          border: self.opt.cursorborder,
          'background-clip': 'padding-box',
          '-webkit-border-radius': self.opt.cursorborderradius,
          '-moz-border-radius': self.opt.cursorborderradius,
          'border-radius': self.opt.cursorborderradius
        });

        cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight());
        
        cursor.addClass('nicescroll-cursors');
        
        self.cursor = cursor;

        var rail = $(document.createElement('div'));
        rail.attr('id', self.id);
        rail.addClass('nicescroll-rails nicescroll-rails-vr');

        var v, a, kp = ["left","right","top","bottom"];  //**
        for (var n in kp) {
          a = kp[n];
          v = self.opt.railpadding[a];
          (v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0;
        }

        rail.append(cursor);

        rail.width = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerWidth());
        rail.css({
          width: rail.width + "px",
          zIndex: self.zindex,
          background: self.opt.background,
          cursor: "default"
        });

        rail.visibility = true;
        rail.scrollable = true;

        rail.align = (self.opt.railalign == "left") ? 0 : 1;

        self.rail = rail;

        self.rail.drag = false;

        var zoom = false;
        if (self.opt.boxzoom && !self.ispage && !cap.isieold) {
          zoom = document.createElement('div');

          self.bind(zoom, "click", self.doZoom);
          self.bind(zoom, "mouseenter", function() {
            self.zoom.css('opacity', self.opt.cursoropacitymax);
          });
          self.bind(zoom, "mouseleave", function() {
            self.zoom.css('opacity', self.opt.cursoropacitymin);
          });

          self.zoom = $(zoom);
          self.zoom.css({
            cursor: "pointer",
            zIndex: self.zindex,
            backgroundImage: 'url(' + self.opt.scriptpath + 'zoomico.png)',
            height: 18,
            width: 18,
            backgroundPosition: '0px 0px'
          });
          if (self.opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom);
          if (cap.cantouch && self.opt.gesturezoom) {
            self.ongesturezoom = function(e) {
              if (e.scale > 1.5) self.doZoomIn(e);
              if (e.scale < 0.8) self.doZoomOut(e);
              return self.cancelEvent(e);
            };
            self.bind(self.win, "gestureend", self.ongesturezoom);
          }
        }

        // init HORIZ

        self.railh = false;
        var railh;

        if (self.opt.horizrailenabled) {

          self.css(cont, {
            overflowX: 'hidden'
          });

          var cursor = $(document.createElement('div'));
          cursor.css({
            position: "absolute",
            top: 0,
            height: self.opt.cursorwidth,
            width: 0,
            backgroundColor: self.opt.cursorcolor,
            border: self.opt.cursorborder,
            backgroundClip: 'padding-box',
            '-webkit-border-radius': self.opt.cursorborderradius,
            '-moz-border-radius': self.opt.cursorborderradius,
            'border-radius': self.opt.cursorborderradius
          });

          if (cap.isieold) cursor.css('overflow', 'hidden');  //IE6 horiz scrollbar issue
          
          cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth());
          
          cursor.addClass('nicescroll-cursors');
          
          self.cursorh = cursor;

          railh = $(document.createElement('div'));
          railh.attr('id', self.id + '-hr');
          railh.addClass('nicescroll-rails nicescroll-rails-hr');
          railh.height = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerHeight());
          railh.css({
            height: railh.height + "px",
            'zIndex': self.zindex,
            "background": self.opt.background
          });

          railh.append(cursor);

          railh.visibility = true;
          railh.scrollable = true;

          railh.align = (self.opt.railvalign == "top") ? 0 : 1;

          self.railh = railh;

          self.railh.drag = false;

        }

        //        

        if (self.ispage) {
          rail.css({
            position: "fixed",
            top: 0,
            height: "100%"
          });
          (rail.align) ? rail.css({
            right: 0
          }): rail.css({
            left: 0
          });
          self.body.append(rail);
          if (self.railh) {
            railh.css({
              position: "fixed",
              left: 0,
              width: "100%"
            });
            (railh.align) ? railh.css({
              bottom: 0
            }): railh.css({
              top: 0
            });
            self.body.append(railh);
          }
        } else {
          if (self.ishwscroll) {
            if (self.win.css('position') == 'static') self.css(self.win, {
              'position': 'relative'
            });
            var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win;
            $(bd).scrollTop(0).scrollLeft(0);  // fix rail position if content already scrolled
            if (self.zoom) {
              self.zoom.css({
                position: "absolute",
                top: 1,
                right: 0,
                "margin-right": rail.width + 4
              });
              bd.append(self.zoom);
            }
            rail.css({
              position: "absolute",
              top: 0
            });
            (rail.align) ? rail.css({
              right: 0
            }): rail.css({
              left: 0
            });
            bd.append(rail);
            if (railh) {
              railh.css({
                position: "absolute",
                left: 0,
                bottom: 0
              });
              (railh.align) ? railh.css({
                bottom: 0
              }): railh.css({
                top: 0
              });
              bd.append(railh);
            }
          } else {
            self.isfixed = (self.win.css("position") == "fixed");
            var rlpos = (self.isfixed) ? "fixed" : "absolute";

            if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);
            if (self.viewport) {
              self.body = self.viewport;
              if ((/fixed|absolute/.test(self.viewport.css("position"))) == false) self.css(self.viewport, {
                "position": "relative"
              });
            }

            rail.css({
              position: rlpos
            });
            if (self.zoom) self.zoom.css({
              position: rlpos
            });
            self.updateScrollBar();
            self.body.append(rail);
            if (self.zoom) self.body.append(self.zoom);
            if (self.railh) {
              railh.css({
                position: rlpos
              });
              self.body.append(railh);
            }
          }

          if (cap.isios) self.css(self.win, {
            '-webkit-tap-highlight-color': 'rgba(0,0,0,0)',
            '-webkit-touch-callout': 'none'
          }); // prevent grey layer on click

          if (cap.isie && self.opt.disableoutline) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div
          if (cap.iswebkit && self.opt.disableoutline) self.win.css('outline', 'none');  // Webkit outline
          //if (cap.isopera&&self.opt.disableoutline) self.win.css({"outline":"0"});  // Opera 12- to test [TODO]

        }

        if (self.opt.autohidemode === false) {
          self.autohidedom = false;
          self.rail.css({
            opacity: self.opt.cursoropacitymax
          });
          if (self.railh) self.railh.css({
            opacity: self.opt.cursoropacitymax
          });
        } else if ((self.opt.autohidemode === true) || (self.opt.autohidemode === "leave")) {
          self.autohidedom = $().add(self.rail);
          if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor);
          if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
          if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh);
        } else if (self.opt.autohidemode == "scroll") {
          self.autohidedom = $().add(self.rail);
          if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
        } else if (self.opt.autohidemode == "cursor") {
          self.autohidedom = $().add(self.cursor);
          if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh);
        } else if (self.opt.autohidemode == "hidden") {
          self.autohidedom = false;
          self.hide();
          self.railslocked = false;
        }

        if (cap.isie9mobile) {

          self.scrollmom = new ScrollMomentumClass2D(self);

          self.onmangotouch = function() {
            var py = self.getScrollTop();
            var px = self.getScrollLeft();

            if ((py == self.scrollmom.lastscrolly) && (px == self.scrollmom.lastscrollx)) return true;

            var dfy = py - self.mangotouch.sy;
            var dfx = px - self.mangotouch.sx;
            var df = Math.round(Math.sqrt(Math.pow(dfx, 2) + Math.pow(dfy, 2)));
            if (df == 0) return;

            var dry = (dfy < 0) ? -1 : 1;
            var drx = (dfx < 0) ? -1 : 1;

            var tm = +new Date();
            if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy);

            if (((tm - self.mangotouch.tm) > 80) || (self.mangotouch.dry != dry) || (self.mangotouch.drx != drx)) {
              self.scrollmom.stop();
              self.scrollmom.reset(px, py);
              self.mangotouch.sy = py;
              self.mangotouch.ly = py;
              self.mangotouch.sx = px;
              self.mangotouch.lx = px;
              self.mangotouch.dry = dry;
              self.mangotouch.drx = drx;
              self.mangotouch.tm = tm;
            } else {

              self.scrollmom.stop();
              self.scrollmom.update(self.mangotouch.sx - dfx, self.mangotouch.sy - dfy);
              self.mangotouch.tm = tm;

              var ds = Math.max(Math.abs(self.mangotouch.ly - py), Math.abs(self.mangotouch.lx - px));
              self.mangotouch.ly = py;
              self.mangotouch.lx = px;

              if (ds > 2) {
                self.mangotouch.lazy = setTimeout(function() {
                  self.mangotouch.lazy = false;
                  self.mangotouch.dry = 0;
                  self.mangotouch.drx = 0;
                  self.mangotouch.tm = 0;
                  self.scrollmom.doMomentum(30);
                }, 100);
              }
            }
          };

          var top = self.getScrollTop();
          var lef = self.getScrollLeft();
          self.mangotouch = {
            sy: top,
            ly: top,
            dry: 0,
            sx: lef,
            lx: lef,
            drx: 0,
            lazy: false,
            tm: 0
          };

          self.bind(self.docscroll, "scroll", self.onmangotouch);

        } else {

          if (cap.cantouch || self.istouchcapable || self.opt.touchbehavior || cap.hasmstouch) {

            self.scrollmom = new ScrollMomentumClass2D(self);

            self.ontouchstart = function(e) {
              if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
              
              self.hasmoving = false;

              if (!self.railslocked) {
                var tg;
                if (cap.hasmstouch) {
                  tg = (e.target) ? e.target : false;
                  while (tg) {
                    var nc = $(tg).getNiceScroll();
                    if ((nc.length > 0) && (nc[0].me == self.me)) break;
                    if (nc.length > 0) return false;
                    if ((tg.nodeName == 'DIV') && (tg.id == self.id)) break;
                    tg = (tg.parentNode) ? tg.parentNode : false;
                  }
                }

                self.cancelScroll();

                tg = self.getTarget(e);

                if (tg) {
                  var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type));
                  if (skp) return self.stopPropagation(e);
                }

                if (!("clientX" in e) && ("changedTouches" in e)) {
                  e.clientX = e.changedTouches[0].clientX;
                  e.clientY = e.changedTouches[0].clientY;
                }

                if (self.forcescreen) {
                  var le = e;
                  e = {
                    "original": (e.original) ? e.original : e
                  };
                  e.clientX = le.screenX;
                  e.clientY = le.screenY;
                }

                self.rail.drag = {
                  x: e.clientX,
                  y: e.clientY,
                  sx: self.scroll.x,
                  sy: self.scroll.y,
                  st: self.getScrollTop(),
                  sl: self.getScrollLeft(),
                  pt: 2,
                  dl: false
                };

                if (self.ispage || !self.opt.directionlockdeadzone) {
                  self.rail.drag.dl = "f";
                } else {

                  var view = {
                    w: $(window).width(),
                    h: $(window).height()
                  };

                  var page = {
                    w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
                    h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
                  };

                  var maxh = Math.max(0, page.h - view.h);
                  var maxw = Math.max(0, page.w - view.w);

                  if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false;
                  else if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false;
                  else self.rail.drag.ck = false;
                  if (!self.rail.drag.ck) self.rail.drag.dl = "f";
                }

                if (self.opt.touchbehavior && self.isiframe && cap.isie) {
                  var wp = self.win.position();
                  self.rail.drag.x += wp.left;
                  self.rail.drag.y += wp.top;
                }

                self.hasmoving = false;
                self.lastmouseup = false;
                self.scrollmom.reset(e.clientX, e.clientY);
                
                if (!cap.cantouch && !this.istouchcapable && !e.pointerType) {       
                
                  var ip = (tg) ? /INPUT|SELECT|TEXTAREA/i.test(tg.nodeName) : false;
                  if (!ip) {
                    if (!self.ispage && cap.hasmousecapture) tg.setCapture();
                    if (self.opt.touchbehavior) {
                      if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
                        tg._onclick = tg.onclick;
                        tg.onclick = function(e) {
                          if (self.hasmoving) return false;
                          tg._onclick.call(this, e);
                        };
                      }
                      return self.cancelEvent(e);
                    }
                    return self.stopPropagation(e);
                  }

                  if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
                    pc = {
                      "tg": tg,
                      "click": false
                    };
                    self.preventclick = pc;
                  }

                }
              }

            };

            self.ontouchend = function(e) {              
              if (!self.rail.drag) return true;              
              if (self.rail.drag.pt == 2) {
                if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
								
                self.scrollmom.doMomentum();
                self.rail.drag = false;
                if (self.hasmoving) {
                  self.lastmouseup = true;
                  self.hideCursor();
                  if (cap.hasmousecapture) document.releaseCapture();
                  if (!cap.cantouch) return self.cancelEvent(e);
                }
              }
              else if (self.rail.drag.pt == 1) {
                return self.onmouseup(e);
              }

            };

            var moveneedoffset = (self.opt.touchbehavior && self.isiframe && !cap.hasmousecapture);

            self.ontouchmove = function(e, byiframe) {

              if (!self.rail.drag) return false;
            
              if (e.targetTouches && self.opt.preventmultitouchscrolling) {
                if (e.targetTouches.length > 1) return false; // multitouch
              }
            
              if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
          
              if (self.rail.drag.pt == 2) {
                if (cap.cantouch && (cap.isios) && e.original === undefined) return true; // prevent ios "ghost" events by clickable elements

                self.hasmoving = true;

                if (self.preventclick && !self.preventclick.click) {
                  self.preventclick.click = self.preventclick.tg.onclick || false;
                  self.preventclick.tg.onclick = self.onpreventclick;
                }

                var ev = $.extend({
                  "original": e
                }, e);
                e = ev;

                if (("changedTouches" in e)) {
                  e.clientX = e.changedTouches[0].clientX;
                  e.clientY = e.changedTouches[0].clientY;
                }

                if (self.forcescreen) {
                  var le = e;
                  e = {
                    "original": (e.original) ? e.original : e
                  };
                  e.clientX = le.screenX;
                  e.clientY = le.screenY;
                }

                var ofy,ofx;
                ofx = ofy = 0;

                if (moveneedoffset && !byiframe) {
                  var wp = self.win.position();
                  ofx = -wp.left;
                  ofy = -wp.top;
                }

                var fy = e.clientY + ofy;
                var my = (fy - self.rail.drag.y);
                var fx = e.clientX + ofx;
                var mx = (fx - self.rail.drag.x);

                var ny = self.rail.drag.st - my;

                if (self.ishwscroll && self.opt.bouncescroll) {
                  if (ny < 0) {
                    ny = Math.round(ny / 2);
                    //                    fy = 0;
                  } else if (ny > self.page.maxh) {
                    ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2);
                    //                    fy = 0;
                  }
                } else {
                  if (ny < 0) {
                    ny = 0;
                    fy = 0;
                  }
                  if (ny > self.page.maxh) {
                    ny = self.page.maxh;
                    fy = 0;
                  }
                }

                var nx;
                if (self.railh && self.railh.scrollable) {
                  nx = (self.isrtlmode) ? mx - self.rail.drag.sl : self.rail.drag.sl - mx;

                  if (self.ishwscroll && self.opt.bouncescroll) {
                    if (nx < 0) {
                      nx = Math.round(nx / 2);
                      //                      fx = 0;
                    } else if (nx > self.page.maxw) {
                      nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2);
                      //                      fx = 0;
                    }
                  } else {
                    if (nx < 0) {
                      nx = 0;
                      fx = 0;
                    }
                    if (nx > self.page.maxw) {
                      nx = self.page.maxw;
                      fx = 0;
                    }
                  }

                }

                var grabbed = false;
                if (self.rail.drag.dl) {
                  grabbed = true;
                  if (self.rail.drag.dl == "v") nx = self.rail.drag.sl;
                  else if (self.rail.drag.dl == "h") ny = self.rail.drag.st;
                } else {
                  var ay = Math.abs(my);
                  var ax = Math.abs(mx);
                  var dz = self.opt.directionlockdeadzone;
                  if (self.rail.drag.ck == "v") {
                    if (ay > dz && (ax <= (ay * 0.3))) {
                      self.rail.drag = false;
                      return true;
                    } else if (ax > dz) {
                      self.rail.drag.dl = "f";
                      $("body").scrollTop($("body").scrollTop()); // stop iOS native scrolling (when active javascript has blocked)
                    }
                  } else if (self.rail.drag.ck == "h") {
                    if (ax > dz && (ay <= (ax * 0.3))) {
                      self.rail.drag = false;
                      return true;
                    } else if (ay > dz) {
                      self.rail.drag.dl = "f";
                      $("body").scrollLeft($("body").scrollLeft()); // stop iOS native scrolling (when active javascript has blocked)
                    }
                  }
                }

                self.synched("touchmove", function() {
                  if (self.rail.drag && (self.rail.drag.pt == 2)) {
                    if (self.prepareTransition) self.prepareTransition(0);
                    if (self.rail.scrollable) self.setScrollTop(ny);
                    self.scrollmom.update(fx, fy);
                    if (self.railh && self.railh.scrollable) {
                      self.setScrollLeft(nx);
                      self.showCursor(ny, nx);
                    } else {
                      self.showCursor(ny);
                    }
                    if (cap.isie10) document.selection.clear();
                  }
                });

                if (cap.ischrome && self.istouchcapable) grabbed = false; //chrome touch emulation doesn't like!
                if (grabbed) return self.cancelEvent(e);
              }
              else if (self.rail.drag.pt == 1) { // drag on cursor
                return self.onmousemove(e);
              }

            };

          }

          self.onmousedown = function(e, hronly) {
            if (self.rail.drag && self.rail.drag.pt != 1) return;
            if (self.railslocked) return self.cancelEvent(e);
            self.cancelScroll();
            self.rail.drag = {
              x: e.clientX,
              y: e.clientY,
              sx: self.scroll.x,
              sy: self.scroll.y,
              pt: 1,
              hr: (!!hronly)
            };
            var tg = self.getTarget(e);
            if (!self.ispage && cap.hasmousecapture) tg.setCapture();
            if (self.isiframe && !cap.hasmousecapture) {
              self.saved.csspointerevents = self.doc.css("pointer-events");
              self.css(self.doc, {
                "pointer-events": "none"
              });
            }
            self.hasmoving = false;
            return self.cancelEvent(e);
          };

          self.onmouseup = function(e) {
            if (self.rail.drag) {
              if (self.rail.drag.pt != 1) return true;
							
              if (cap.hasmousecapture) document.releaseCapture();
              if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);              
              self.rail.drag = false;
              //if (!self.rail.active) self.hideCursor();
              if (self.hasmoving) self.triggerScrollEnd(); // TODO - check &&!self.scrollrunning
              return self.cancelEvent(e);
            }
          };

          self.onmousemove = function(e) {
            if (self.rail.drag) {
              if (self.rail.drag.pt != 1) return;

              if (cap.ischrome && e.which == 0) return self.onmouseup(e);

              self.cursorfreezed = true;
              self.hasmoving = true;

              if (self.rail.drag.hr) {
                self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x);
                if (self.scroll.x < 0) self.scroll.x = 0;
                var mw = self.scrollvaluemaxw;
                if (self.scroll.x > mw) self.scroll.x = mw;
              } else {
                self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y);
                if (self.scroll.y < 0) self.scroll.y = 0;
                var my = self.scrollvaluemax;
                if (self.scroll.y > my) self.scroll.y = my;
              }

              self.synched('mousemove', function() {
                if (self.rail.drag && (self.rail.drag.pt == 1)) {
                  self.showCursor();
                  if (self.rail.drag.hr) {
                    if (self.hasreversehr) {
                      self.doScrollLeft(self.scrollvaluemaxw-Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
                    } else {
                      self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
                    }
                  }
                  else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), self.opt.cursordragspeed);
                }
              });

              return self.cancelEvent(e);
            }
            else {
              self.checkarea = 0;
            }
          };

          if (cap.cantouch || self.opt.touchbehavior) {

            self.onpreventclick = function(e) {
              if (self.preventclick) {
                self.preventclick.tg.onclick = self.preventclick.click;
                self.preventclick = false;
                return self.cancelEvent(e);
              }
            };

            self.bind(self.win, "mousedown", self.ontouchstart); // control content dragging

            self.onclick = (cap.isios) ? false : function(e) {  // it needs to check IE11 ???
              if (self.lastmouseup) {
                self.lastmouseup = false;
                return self.cancelEvent(e);
              } else {
                return true;
              }
            };

            if (self.opt.grabcursorenabled && cap.cursorgrabvalue) {
              self.css((self.ispage) ? self.doc : self.win, {
                'cursor': cap.cursorgrabvalue
              });
              self.css(self.rail, {
                'cursor': cap.cursorgrabvalue
              });
            }

          } else {

            var checkSelectionScroll = function(e) {
              if (!self.selectiondrag) return;

              if (e) {
                var ww = self.win.outerHeight();
                var df = (e.pageY - self.selectiondrag.top);
                if (df > 0 && df < ww) df = 0;
                if (df >= ww) df -= ww;
                self.selectiondrag.df = df;
              }
              if (self.selectiondrag.df == 0) return;

              var rt = -Math.floor(self.selectiondrag.df / 6) * 2;
              self.doScrollBy(rt);

              self.debounced("doselectionscroll", function() {
                checkSelectionScroll();
              }, 50);
            };

            if ("getSelection" in document) { // A grade - Major browsers
              self.hasTextSelected = function() {
                return (document.getSelection().rangeCount > 0);
              };
            } else if ("selection" in document) { //IE9-
              self.hasTextSelected = function() {
                return (document.selection.type != "None");
              };
            } else {
              self.hasTextSelected = function() { // no support
                return false;
              };
            }

            self.onselectionstart = function(e) {
/*  More testing - severe chrome issues            
              if (!self.haswrapper&&(e.which&&e.which==2)) {  // fool browser to manage middle button scrolling
                self.win.css({'overflow':'auto'});
                setTimeout(function(){
                  self.win.css({'overflow':''});
                },10);                
                return true;
              }            
*/              
              if (self.ispage) return;
              self.selectiondrag = self.win.offset();
            };
            
            self.onselectionend = function(e) {
              self.selectiondrag = false;
            };
            self.onselectiondrag = function(e) {
              if (!self.selectiondrag) return;
              if (self.hasTextSelected()) self.debounced("selectionscroll", function() {
                checkSelectionScroll(e);
              }, 250);
            };


          }

          if (cap.hasw3ctouch) { //IE11+
            self.css(self.rail, {
              'touch-action': 'none'
            });
            self.css(self.cursor, {
              'touch-action': 'none'
            });
            self.bind(self.win, "pointerdown", self.ontouchstart);
            self.bind(document, "pointerup", self.ontouchend);
            self.bind(document, "pointermove", self.ontouchmove);
          } else if (cap.hasmstouch) { //IE10
            self.css(self.rail, {
              '-ms-touch-action': 'none'
            });
            self.css(self.cursor, {
              '-ms-touch-action': 'none'
            });
            self.bind(self.win, "MSPointerDown", self.ontouchstart);
            self.bind(document, "MSPointerUp", self.ontouchend);
            self.bind(document, "MSPointerMove", self.ontouchmove);
            self.bind(self.cursor, "MSGestureHold", function(e) {
              e.preventDefault();
            });
            self.bind(self.cursor, "contextmenu", function(e) {
              e.preventDefault();
            });
          } else if (this.istouchcapable) { //desktop with screen touch enabled
            self.bind(self.win, "touchstart", self.ontouchstart);
            self.bind(document, "touchend", self.ontouchend);
            self.bind(document, "touchcancel", self.ontouchend);
            self.bind(document, "touchmove", self.ontouchmove);
          }

          
          if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.touchbehavior)) {

            self.rail.css({
              cursor: "default"
            });
            self.railh && self.railh.css({
              cursor: "default"
            });

            self.jqbind(self.rail, "mouseenter", function() {
              if (!self.ispage && !self.win.is(":visible")) return false;
              if (self.canshowonmouseevent) self.showCursor();
              self.rail.active = true;
            });
            self.jqbind(self.rail, "mouseleave", function() {
              self.rail.active = false;
              if (!self.rail.drag) self.hideCursor();
            });

            if (self.opt.sensitiverail) {
              self.bind(self.rail, "click", function(e) {
                self.doRailClick(e, false, false);
              });
              self.bind(self.rail, "dblclick", function(e) {
                self.doRailClick(e, true, false);
              });
              self.bind(self.cursor, "click", function(e) {
                self.cancelEvent(e);
              });
              self.bind(self.cursor, "dblclick", function(e) {
                self.cancelEvent(e);
              });
            }

            if (self.railh) {
              self.jqbind(self.railh, "mouseenter", function() {
                if (!self.ispage && !self.win.is(":visible")) return false;
                if (self.canshowonmouseevent) self.showCursor();
                self.rail.active = true;
              });
              self.jqbind(self.railh, "mouseleave", function() {
                self.rail.active = false;
                if (!self.rail.drag) self.hideCursor();
              });

              if (self.opt.sensitiverail) {
                self.bind(self.railh, "click", function(e) {
                  self.doRailClick(e, false, true);
                });
                self.bind(self.railh, "dblclick", function(e) {
                  self.doRailClick(e, true, true);
                });
                self.bind(self.cursorh, "click", function(e) {
                  self.cancelEvent(e);
                });
                self.bind(self.cursorh, "dblclick", function(e) {
                  self.cancelEvent(e);
                });
              }

            }

          }

          if (!cap.cantouch && !self.opt.touchbehavior) {

            self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.onmouseup);
            self.bind(document, "mousemove", self.onmousemove);
            if (self.onclick) self.bind(document, "click", self.onclick);

            self.bind(self.cursor, "mousedown", self.onmousedown);
            self.bind(self.cursor, "mouseup", self.onmouseup);

            if (self.railh) {
              self.bind(self.cursorh, "mousedown", function(e) {
                self.onmousedown(e, true);
              });
              self.bind(self.cursorh, "mouseup", self.onmouseup);
            }
            
            if (!self.ispage && self.opt.enablescrollonselection) {
              self.bind(self.win[0], "mousedown", self.onselectionstart);
              self.bind(document, "mouseup", self.onselectionend);
              self.bind(self.cursor, "mouseup", self.onselectionend);
              if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend);
              self.bind(document, "mousemove", self.onselectiondrag);
            }

            if (self.zoom) {
              self.jqbind(self.zoom, "mouseenter", function() {
                if (self.canshowonmouseevent) self.showCursor();
                self.rail.active = true;
              });
              self.jqbind(self.zoom, "mouseleave", function() {
                self.rail.active = false;
                if (!self.rail.drag) self.hideCursor();
              });
            }

          } else {

            self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.ontouchend);
            self.bind(document, "mousemove", self.ontouchmove);
            if (self.onclick) self.bind(document, "click", self.onclick);

            if (self.opt.cursordragontouch) {
              self.bind(self.cursor, "mousedown", self.onmousedown);
              self.bind(self.cursor, "mouseup", self.onmouseup);
              //self.bind(self.cursor, "mousemove", self.onmousemove);
              self.cursorh && self.bind(self.cursorh, "mousedown", function(e) {
                self.onmousedown(e, true);
              });
              //self.cursorh && self.bind(self.cursorh, "mousemove", self.onmousemove);
              self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup);
            } else {
              self.bind(self.rail, "mousedown", function(e){e.preventDefault();});  // prevent text selection             
							self.railh&&self.bind(self.railh, "mousedown", function(e){e.preventDefault();});
            }

          }
            

          if (self.opt.enablemousewheel) {
            if (!self.isiframe) self.mousewheel((cap.isie && self.ispage) ? document : self.win , self.onmousewheel);
            self.mousewheel(self.rail, self.onmousewheel);
            if (self.railh) self.mousewheel(self.railh, self.onmousewheelhr);
          }

          if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) {
            if (!self.win.attr("tabindex")) self.win.attr({
              "tabindex": tabindexcounter++
            });

            self.jqbind(self.win, "focus", function(e) {
              domfocus = (self.getTarget(e)).id || true;
              self.hasfocus = true;
              if (self.canshowonmouseevent) self.noticeCursor();
            });
            self.jqbind(self.win, "blur", function(e) {
              domfocus = false;
              self.hasfocus = false;
            });

            self.jqbind(self.win, "mouseenter", function(e) {
              mousefocus = (self.getTarget(e)).id || true;
              self.hasmousefocus = true;
              if (self.canshowonmouseevent) self.noticeCursor();
            });
            self.jqbind(self.win, "mouseleave", function() {
              mousefocus = false;
              self.hasmousefocus = false;
              if (!self.rail.drag) self.hideCursor();
            });

          }

        } // !ie9mobile

        //Thanks to http://www.quirksmode.org !!
        self.onkeypress = function(e) {
          if (self.railslocked && self.page.maxh == 0) return true;

          e = (e) ? e : window.e;
          var tg = self.getTarget(e);
          if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {
            var tp = tg.getAttribute('type') || tg.type || false;
            if ((!tp) || !(/submit|button|cancel/i.tp)) return true;
          }

          if ($(tg).attr('contenteditable')) return true;

          if (self.hasfocus || (self.hasmousefocus && !domfocus) || (self.ispage && !domfocus && !mousefocus)) {
            var key = e.keyCode;

            if (self.railslocked && key != 27) return self.cancelEvent(e);

            var ctrl = e.ctrlKey || false;
            var shift = e.shiftKey || false;

            var ret = false;
            switch (key) {
              case 38:
              case 63233: //safari
                self.doScrollBy(24 * 3);
                ret = true;
                break;
              case 40:
              case 63235: //safari
                self.doScrollBy(-24 * 3);
                ret = true;
                break;
              case 37:
              case 63232: //safari
                if (self.railh) {
                  (ctrl) ? self.doScrollLeft(0): self.doScrollLeftBy(24 * 3);
                  ret = true;
                }
                break;
              case 39:
              case 63234: //safari
                if (self.railh) {
                  (ctrl) ? self.doScrollLeft(self.page.maxw): self.doScrollLeftBy(-24 * 3);
                  ret = true;
                }
                break;
              case 33:
              case 63276: // safari
                self.doScrollBy(self.view.h);
                ret = true;
                break;
              case 34:
              case 63277: // safari
                self.doScrollBy(-self.view.h);
                ret = true;
                break;
              case 36:
              case 63273: // safari                
                (self.railh && ctrl) ? self.doScrollPos(0, 0): self.doScrollTo(0);
                ret = true;
                break;
              case 35:
              case 63275: // safari
                (self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh): self.doScrollTo(self.page.maxh);
                ret = true;
                break;
              case 32:
                if (self.opt.spacebarenabled) {
                  (shift) ? self.doScrollBy(self.view.h): self.doScrollBy(-self.view.h);
                  ret = true;
                }
                break;
              case 27: // ESC
                if (self.zoomactive) {
                  self.doZoom();
                  ret = true;
                }
                break;
            }
            if (ret) return self.cancelEvent(e);
          }
        };

        if (self.opt.enablekeyboard) self.bind(document, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress);

        self.bind(document, "keydown", function(e) {
          var ctrl = e.ctrlKey || false;
          if (ctrl) self.wheelprevented = true;
        });
        self.bind(document, "keyup", function(e) {
          var ctrl = e.ctrlKey || false;
          if (!ctrl) self.wheelprevented = false;
        });
        self.bind(window,"blur",function(e){
          self.wheelprevented = false;
        });        

        self.bind(window, 'resize', self.lazyResize);
        self.bind(window, 'orientationchange', self.lazyResize);

        self.bind(window, "load", self.lazyResize);

        if (cap.ischrome && !self.ispage && !self.haswrapper) { //chrome void scrollbar bug - it persists in version 26
          var tmp = self.win.attr("style");
          var ww = parseFloat(self.win.css("width")) + 1;
          self.win.css('width', ww);
          self.synched("chromefix", function() {
            self.win.attr("style", tmp);
          });
        }


        // Trying a cross-browser implementation - good luck!

        self.onAttributeChange = function(e) {
          self.lazyResize(self.isieold ? 250 : 30);
        };

        if ((!self.isie11) && (ClsMutationObserver !== false)) {  // IE11 crashes  #568
          self.observerbody = new ClsMutationObserver(function(mutations) {
            mutations.forEach(function(mut){
              if (mut.type=="attributes") {
                return ($("body").hasClass("modal-open") && $("body").hasClass("modal-dialog") && !$.contains($('.modal-dialog')[0],self.doc[0])) ? self.hide() : self.show();  // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal
              }
            });  
            if (document.body.scrollHeight!=self.page.maxh) return self.lazyResize(30);
          });
          self.observerbody.observe(document.body, {
            childList: true,
            subtree: true,
            characterData: false,
            attributes: true,
            attributeFilter: ['class']
          });
        }
        
        if (!self.ispage && !self.haswrapper) {
          // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
          if (ClsMutationObserver !== false) {
            self.observer = new ClsMutationObserver(function(mutations) {
              mutations.forEach(self.onAttributeChange);
            });
            self.observer.observe(self.win[0], {
              childList: true,
              characterData: false,
              attributes: true,
              subtree: false
            });
            self.observerremover = new ClsMutationObserver(function(mutations) {
              mutations.forEach(function(mo) {
                if (mo.removedNodes.length > 0) {
                  for (var dd in mo.removedNodes) {
                    if (!!self && (mo.removedNodes[dd] == self.win[0])) return self.remove();
                  }
                }
              });
            });
            self.observerremover.observe(self.win[0].parentNode, {
              childList: true,
              characterData: false,
              attributes: false,
              subtree: false
            });
          } else {
            self.bind(self.win, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
            if (cap.isie9) self.win[0].attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
            self.bind(self.win, "DOMNodeRemoved", function(e) {
              if (e.target == self.win[0]) self.remove();
            });
          }
        }

        //

        if (!self.ispage && self.opt.boxzoom) self.bind(window, "resize", self.resizeZoom);
				if (self.istextarea) {
					self.bind(self.win, "keydown", self.lazyResize);
					self.bind(self.win, "mouseup", self.lazyResize);
				}

        //        self.checkrtlmode = true;
        self.lazyResize(30);

      }
      
      if (this.doc[0].nodeName == 'IFRAME') {
        var oniframeload = function() {
          self.iframexd = false;
          var doc;
          try {
            doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document;
            var a = doc.domain;
          } catch (e) {
            self.iframexd = true;
            doc = false;
          }
          
          if (self.iframexd) {
            if ("console" in window) console.log('NiceScroll error: policy restriced iframe');
            return true; //cross-domain - I can't manage this        
          }

          self.forcescreen = true;

          if (self.isiframe) {
            self.iframe = {
              "doc": $(doc),
              "html": self.doc.contents().find('html')[0],
              "body": self.doc.contents().find('body')[0]
            };
            self.getContentSize = function() {
              return {
                w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth),
                h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight)
              };
            };
            self.docscroll = $(self.iframe.body); //$(this.contentWindow);
          }

          if (!cap.isios && self.opt.iframeautoresize && !self.isiframe) {
            self.win.scrollTop(0); // reset position
            self.doc.height(""); //reset height to fix browser bug
            var hh = Math.max(doc.getElementsByTagName('html')[0].scrollHeight, doc.body.scrollHeight);
            self.doc.height(hh);
          }
          self.lazyResize(30);

          if (cap.isie7) self.css($(self.iframe.html), _scrollyhidden);
          self.css($(self.iframe.body), _scrollyhidden);

          if (cap.isios && self.haswrapper) {
            self.css($(doc.body), {
              '-webkit-transform': 'translate3d(0,0,0)'
            }); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/
          }

          if ('contentWindow' in this) {
            self.bind(this.contentWindow, "scroll", self.onscroll); //IE8 & minor
          } else {
            self.bind(doc, "scroll", self.onscroll);
          }

          if (self.opt.enablemousewheel) {
            self.mousewheel(doc, self.onmousewheel);
          }

          if (self.opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);

          if (cap.cantouch || self.opt.touchbehavior) {
            self.bind(doc, "mousedown", self.ontouchstart);
            self.bind(doc, "mousemove", function(e) {
              return self.ontouchmove(e, true);
            });
            if (self.opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), {
              'cursor': cap.cursorgrabvalue
            });
          }

          self.bind(doc, "mouseup", self.ontouchend);

          if (self.zoom) {
            if (self.opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom);
            if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom);
          }
        };

        if (this.doc[0].readyState && this.doc[0].readyState == "complete") {
          setTimeout(function() {
            oniframeload.call(self.doc[0], false);
          }, 500);
        }
        self.bind(this.doc, "load", oniframeload);

      }

    };

    this.showCursor = function(py, px) {
      if (self.cursortimeout) {
        clearTimeout(self.cursortimeout);
        self.cursortimeout = 0;
      }
      if (!self.rail) return;
      if (self.autohidedom) {
        self.autohidedom.stop().css({
          opacity: self.opt.cursoropacitymax
        });
        self.cursoractive = true;
      }

      if (!self.rail.drag || self.rail.drag.pt != 1) {
        if (py !== undefined && py !== false) {
          self.scroll.y = Math.round(py * 1 / self.scrollratio.y);
        }
        if (px !== undefined) {
          self.scroll.x = Math.round(px * 1 / self.scrollratio.x);
        }
      }

      self.cursor.css({
        height: self.cursorheight,
        top: self.scroll.y
      });
      if (self.cursorh) {        
        var lx = (self.hasreversehr) ? self.scrollvaluemaxw-self.scroll.x : self.scroll.x;
        (!self.rail.align && self.rail.visibility) ? self.cursorh.css({
          width: self.cursorwidth,
          left: lx + self.rail.width
        }): self.cursorh.css({
          width: self.cursorwidth,
          left: lx
        });
        self.cursoractive = true;
      }

      if (self.zoom) self.zoom.stop().css({
        opacity: self.opt.cursoropacitymax
      });
    };

    this.hideCursor = function(tm) {
      if (self.cursortimeout) return;
      if (!self.rail) return;
      if (!self.autohidedom) return;
      if (self.hasmousefocus && self.opt.autohidemode == "leave") return;
      self.cursortimeout = setTimeout(function() {
        if (!self.rail.active || !self.showonmouseevent) {
          self.autohidedom.stop().animate({
            opacity: self.opt.cursoropacitymin
          });
          if (self.zoom) self.zoom.stop().animate({
            opacity: self.opt.cursoropacitymin
          });
          self.cursoractive = false;
        }
        self.cursortimeout = 0;
      }, tm || self.opt.hidecursordelay);
    };

    this.noticeCursor = function(tm, py, px) {
      self.showCursor(py, px);
      if (!self.rail.active) self.hideCursor(tm);
    };

    this.getContentSize =
      (self.ispage) ?
      function() {
        return {
          w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
          h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
        };
      } : (self.haswrapper) ?
      function() {
        return {
          w: self.doc.outerWidth() + parseInt(self.win.css('paddingLeft')) + parseInt(self.win.css('paddingRight')),
          h: self.doc.outerHeight() + parseInt(self.win.css('paddingTop')) + parseInt(self.win.css('paddingBottom'))
        };
      } : function() {
        return {
          w: self.docscroll[0].scrollWidth,
          h: self.docscroll[0].scrollHeight
        };
      };

    this.onResize = function(e, page) {
    
      if (!self || !self.win) return false;

      if (!self.haswrapper && !self.ispage) {
        if (self.win.css('display') == 'none') {
          if (self.visibility) self.hideRail().hideRailHr();
          return false;
        } else {
          if (!self.hidden && !self.visibility) self.showRail().showRailHr();
        }
      }

      var premaxh = self.page.maxh;
      var premaxw = self.page.maxw;

      var preview = {
        h: self.view.h,
        w: self.view.w
      };

      self.view = {
        w: (self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth),
        h: (self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight)
      };

      self.page = (page) ? page : self.getContentSize();

      self.page.maxh = Math.max(0, self.page.h - self.view.h);
      self.page.maxw = Math.max(0, self.page.w - self.view.w);
      
      if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == preview.w) && (self.view.h == preview.h)) {
        // test position        
        if (!self.ispage) {
          var pos = self.win.offset();
          if (self.lastposition) {
            var lst = self.lastposition;
            if ((lst.top == pos.top) && (lst.left == pos.left)) return self; //nothing to do            
          }
          self.lastposition = pos;
        } else {
          return self; //nothing to do
        }
      }

      if (self.page.maxh == 0) {
        self.hideRail();
        self.scrollvaluemax = 0;
        self.scroll.y = 0;
        self.scrollratio.y = 0;
        self.cursorheight = 0;
        self.setScrollTop(0);
        if (self.rail) self.rail.scrollable = false;
      } else {
        self.page.maxh -= (self.opt.railpadding.top + self.opt.railpadding.bottom);  //**
        self.rail.scrollable = true;
      }

      if (self.page.maxw == 0) {
        self.hideRailHr();
        self.scrollvaluemaxw = 0;
        self.scroll.x = 0;
        self.scrollratio.x = 0;
        self.cursorwidth = 0;
        self.setScrollLeft(0);
        if (self.railh) {
          self.railh.scrollable = false;
        }
      } else {
          self.page.maxw -= (self.opt.railpadding.left + self.opt.railpadding.right);  //**
          if (self.railh) self.railh.scrollable = (self.opt.horizrailenabled);
      }

      self.railslocked = (self.locked) || ((self.page.maxh == 0) && (self.page.maxw == 0));
      if (self.railslocked) {
        if (!self.ispage) self.updateScrollBar(self.view);
        return false;
      }

      if (!self.hidden && !self.visibility) {
        self.showRail().showRailHr();
      }
      else if (self.railh && (!self.hidden && !self.railh.visibility)) self.showRailHr();

      if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') self.view.h -= 20;

      self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h)));
      self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorheight);

      self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w)));
      self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorwidth);

      self.scrollvaluemax = self.view.h - self.cursorheight - self.cursor.hborder - (self.opt.railpadding.top + self.opt.railpadding.bottom);  //**

      if (self.railh) {
        self.railh.width = (self.page.maxh > 0) ? (self.view.w - self.rail.width) : self.view.w;
        self.scrollvaluemaxw = self.railh.width - self.cursorwidth - self.cursorh.wborder - (self.opt.railpadding.left + self.opt.railpadding.right);  //**
      }

      /*
      if (self.checkrtlmode&&self.railh) {
        self.checkrtlmode = false;
        if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw);
      }
*/

      if (!self.ispage) self.updateScrollBar(self.view);

      self.scrollratio = {
        x: (self.page.maxw / self.scrollvaluemaxw),
        y: (self.page.maxh / self.scrollvaluemax)
      };

      var sy = self.getScrollTop();
      if (sy > self.page.maxh) {
        self.doScrollTop(self.page.maxh);
      } else {
        self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
        self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
        if (self.cursoractive) self.noticeCursor();
      }

      if (self.scroll.y && (self.getScrollTop() == 0)) self.doScrollTo(Math.floor(self.scroll.y * self.scrollratio.y));

      return self;
    };

    this.resize = self.onResize;

		this.hlazyresize = 0;
		
    this.lazyResize = function(tm) { // event debounce
/*		
      tm = (isNaN(tm)) ? 30 : tm;
      self.debounced('resize', self.resize, tm);
*/

//			if (!self.haswrapper&&self.opt.autohidemode!==false) self.hide();	
			if (!self.haswrapper) self.hide();	
			if (self.hlazyresize) clearTimeout(self.hlazyresize);
			self.hlazyresize = setTimeout(function(){
				self && self.show().resize();
			},240);
			
      return self;
    };

    // modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel
    function _modernWheelEvent(dom, name, fn, bubble) {
      self._bind(dom, name, function(e) {
        var e = (e) ? e : window.event;
        var event = {
          original: e,
          target: e.target || e.srcElement,
          type: "wheel",
          deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1,
          deltaX: 0,
          deltaZ: 0,
          preventDefault: function() {
            e.preventDefault ? e.preventDefault() : e.returnValue = false;
            return false;
          },
          stopImmediatePropagation: function() {
            (e.stopImmediatePropagation) ? e.stopImmediatePropagation(): e.cancelBubble = true;
          }
        };

        if (name == "mousewheel") {
          e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX);
					e.wheelDeltaY && (event.deltaY = -1 / 40 * e.wheelDeltaY);
					!event.deltaY && !event.deltaX && (event.deltaY = -1 / 40 * e.wheelDelta);
        } else {
          event.deltaY = e.detail;
        }

        return fn.call(dom, event);
      }, bubble);
    }



    this.jqbind = function(dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave)
      self.events.push({
        e: dom,
        n: name,
        f: fn,
        q: true
      });
      $(dom).bind(name, fn);
    };
    
    this.mousewheel = function(dom, fn, bubble) { // bind mousewheel
      var el = ("jquery" in dom) ? dom[0] : dom;
      if ("onwheel" in document.createElement("div")) { // Modern browsers support "wheel"
        self._bind(el, "wheel", fn, bubble || false);
      } else {
        var wname = (document.onmousewheel !== undefined) ? "mousewheel" : "DOMMouseScroll"; // older Webkit+IE support or older Firefox          
        _modernWheelEvent(el, wname, fn, bubble || false);
        if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy
      }
    };
    
    if (cap.haseventlistener) {  // W3C standard event model
    
      this.bind = function(dom, name, fn, bubble) {  // W3C
        var el = ("jquery" in dom) ? dom[0] : dom;
        self._bind(el, name, fn, bubble || false);
      };
    
      this._bind = function(el, name, fn, bubble) { // primitive bind
        self.events.push({
          e: el,
          n: name,
          f: fn,
          b: bubble,
          q: false
        });
        el.addEventListener(name, fn, bubble || false);
      };    
      this.cancelEvent = function(e) {
        if (!e) return false;
        var e = (e.original) ? e.original : e;
        if (e.cancelable) e.preventDefault();
        e.stopPropagation();
        if (e.preventManipulation) e.preventManipulation(); //IE10
        return false;
      };
      this.stopPropagation = function(e) {
        if (!e) return false;
        var e = (e.original) ? e.original : e;
        e.stopPropagation();
        return false;
      };
      this._unbind = function(el, name, fn, bub) { // primitive unbind
        el.removeEventListener(name, fn, bub);
      };
    } else {  // old IE model

      this.bind = function(dom, name, fn, bubble) {  // legacy IE
        var el = ("jquery" in dom) ? dom[0] : dom;
        self._bind(el, name, function(e) {
          e = e || window.event || false;
          if (e && e.srcElement) {
            e.target = e.srcElement;
          }
          if (!("pageY" in e)) {
            e.pageX = e.clientX + document.documentElement.scrollLeft;
            e.pageY = e.clientY + document.documentElement.scrollTop;
          }
          return ((fn.call(el, e) === false) || bubble === false) ? self.cancelEvent(e) : true;
        });
      };
    
      this._bind = function(el, name, fn, bubble) { // primitive bind
        self.events.push({
          e: el,
          n: name,
          f: fn,
          b: bubble,
          q: false
        });
        if (el.attachEvent) {
          el.attachEvent("on" + name, fn);
        } else {
          el["on" + name] = fn;
        }
      };    
      // Thanks to http://www.switchonthecode.com !!
      this.cancelEvent = function(e) {
        var e = window.event || false;
        if (!e) return false;
        e.cancelBubble = true;
        e.cancel = true;
        e.returnValue = false;
        return false;
      };
      this.stopPropagation = function(e) {
        var e = window.event || false;
        if (!e) return false;
        e.cancelBubble = true;
        return false;
      };
      this._unbind = function(el, name, fn, bub) { // primitive unbind IE old
        if (el.detachEvent) {
          el.detachEvent('on' + name, fn);
        } else {
          el['on' + name] = false;
        }
      };
    }
    
    this.unbindAll = function() {
      for (var a = 0; a < self.events.length; a++) {
        var r = self.events[a];
        (r.q) ? r.e.unbind(r.n, r.f): self._unbind(r.e, r.n, r.f, r.b);
      }
    };

    this.showRail = function() {
      if ((self.page.maxh != 0) && (self.ispage || self.win.css('display') != 'none')) {
        self.visibility = true;
        self.rail.visibility = true;
        self.rail.css('display', 'block');
      }
      return self;
    };

    this.showRailHr = function() {
      if (!self.railh) return self;
      if ((self.page.maxw != 0) && (self.ispage || self.win.css('display') != 'none')) {
        self.railh.visibility = true;
        self.railh.css('display', 'block');
      }
      return self;
    };

    this.hideRail = function() {
      self.visibility = false;
      self.rail.visibility = false;
      self.rail.css('display', 'none');
      return self;
    };

    this.hideRailHr = function() {
      if (!self.railh) return self;
      self.railh.visibility = false;
      self.railh.css('display', 'none');
      return self;
    };

    this.show = function() {
      self.hidden = false;
      self.railslocked = false;
      return self.showRail().showRailHr();
    };

    this.hide = function() {
      self.hidden = true;
      self.railslocked = true;
      return self.hideRail().hideRailHr();
    };

    this.toggle = function() {
      return (self.hidden) ? self.show() : self.hide();
    };

    this.remove = function() {
      self.stop();
      if (self.cursortimeout) clearTimeout(self.cursortimeout);
//      if (self.debouncedelayed) clearTimeout(self.debouncedelayed);
			for(var n in self.delaylist) if (self.delaylist[n]) clearAnimationFrame(self.delaylist[n].h);
      self.doZoomOut();
      self.unbindAll();

      if (cap.isie9) self.win[0].detachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug

      if (self.observer !== false) self.observer.disconnect();
      if (self.observerremover !== false) self.observerremover.disconnect();
      if (self.observerbody !== false) self.observerbody.disconnect();

      self.events = null;

      if (self.cursor) {
        self.cursor.remove();
      }
      if (self.cursorh) {
        self.cursorh.remove();
      }
      if (self.rail) {
        self.rail.remove();
      }
      if (self.railh) {
        self.railh.remove();
      }
      if (self.zoom) {
        self.zoom.remove();
      }
      for (var a = 0; a < self.saved.css.length; a++) {
        var d = self.saved.css[a];
        d[0].css(d[1], (d[2] === undefined) ? '' : d[2]);
      }
      self.saved = false;
      self.me.data('__nicescroll', ''); //erase all traces

      // memory leak fixed by GianlucaGuarini - thanks a lot!
      // remove the current nicescroll from the $.nicescroll array & normalize array
      var lst = $.nicescroll;
      lst.each(function(i) {
        if (!this) return;
        if (this.id === self.id) {
          delete lst[i];
          for (var b = ++i; b < lst.length; b++, i++) lst[i] = lst[b];
          lst.length--;
          if (lst.length) delete lst[lst.length];
        }
      });

      for (var i in self) {
        self[i] = null;
        delete self[i];
      }

      self = null;

    };

    this.scrollstart = function(fn) {
      this.onscrollstart = fn;
      return self;
    };
    this.scrollend = function(fn) {
      this.onscrollend = fn;
      return self;
    };
    this.scrollcancel = function(fn) {
      this.onscrollcancel = fn;
      return self;
    };

    this.zoomin = function(fn) {
      this.onzoomin = fn;
      return self;
    };
    this.zoomout = function(fn) {
      this.onzoomout = fn;
      return self;
    };

    this.isScrollable = function(e) {
      var dom = (e.target) ? e.target : e;
      if (dom.nodeName == 'OPTION') return true;
      while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
        var dd = $(dom);
        var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
        if (/scroll|auto/.test(ov)) return (dom.clientHeight != dom.scrollHeight);
        dom = (dom.parentNode) ? dom.parentNode : false;
      }
      return false;
    };

    this.getViewport = function(me) {
      var dom = (me && me.parentNode) ? me.parentNode : false;
      while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
        var dd = $(dom);
        if (/fixed|absolute/.test(dd.css("position"))) return dd;
        var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
        if ((/scroll|auto/.test(ov)) && (dom.clientHeight != dom.scrollHeight)) return dd;
        if (dd.getNiceScroll().length > 0) return dd;
        dom = (dom.parentNode) ? dom.parentNode : false;
      }
      return false; //(dom) ? $(dom) : false;
    };

    this.triggerScrollEnd = function() {
      if (!self.onscrollend) return;

      var px = self.getScrollLeft();
      var py = self.getScrollTop();

      var info = {
        type: "scrollend",
        current: {
          x: px,
          y: py
        },
        end: {
          x: px,
          y: py
        }
      };
      self.onscrollend.call(self, info);
    };

    function execScrollWheel(e, hr, chkscroll) {
      var px, py;
      
      if (e.deltaMode == 0) { // PIXEL
        px = -Math.floor(e.deltaX * (self.opt.mousescrollstep / (18 * 3)));
        py = -Math.floor(e.deltaY * (self.opt.mousescrollstep / (18 * 3)));
      } else if (e.deltaMode == 1) { // LINE
        px = -Math.floor(e.deltaX * self.opt.mousescrollstep);
        py = -Math.floor(e.deltaY * self.opt.mousescrollstep);
      }

      if (hr && self.opt.oneaxismousemode && (px == 0) && py) { // classic vertical-only mousewheel + browser with x/y support 
        px = py;
        py = 0;
      
        if (chkscroll) {
          var hrend = (px < 0) ? (self.getScrollLeft() >= self.page.maxw) : (self.getScrollLeft() <= 0);
          if (hrend) {  // preserve vertical scrolling
            py = px;
            px = 0;            
          }
        }
        
      }

      // invert horizontal direction for rtl mode
      if (self.isrtlmode) px = -px;

      if (px) {
        if (self.scrollmom) {
          self.scrollmom.stop();
        }
        self.lastdeltax += px;
        self.debounced("mousewheelx", function() {
          var dt = self.lastdeltax;
          self.lastdeltax = 0;
          if (!self.rail.drag) {
            self.doScrollLeftBy(dt);
          }
        }, 15);
      }
      if (py) {
        if (self.opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) {
          if (py < 0) {
            if (self.getScrollTop() >= self.page.maxh) return true;
          } else {
            if (self.getScrollTop() <= 0) return true;
          }
        }
        if (self.scrollmom) {
          self.scrollmom.stop();
        }
        self.lastdeltay += py;
//        self.debounced("mousewheely", function() {
	      self.synched("mousewheely", function() {
          var dt = self.lastdeltay;
          self.lastdeltay = 0;
          if (!self.rail.drag) {
            self.doScrollBy(dt);
          }
        }, 15);
      }

      e.stopImmediatePropagation();
      return e.preventDefault();
    }

    this.onmousewheel = function(e) {
      if (self.wheelprevented) return;
      if (self.railslocked) {
        self.debounced("checkunlock", self.resize, 250);
        return true;
      }
      if (self.rail.drag) return self.cancelEvent(e);

      if (self.opt.oneaxismousemode == "auto" && e.deltaX != 0) self.opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant)

      if (self.opt.oneaxismousemode && e.deltaX == 0) {
        if (!self.rail.scrollable) {
          if (self.railh && self.railh.scrollable) {
            return self.onmousewheelhr(e);
          } else {
            return true;
          }
        }
      }

      var nw = +(new Date());
      var chk = false;
      if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
        self.nativescrollingarea = self.isScrollable(e);
        chk = true;
      }
      self.checkarea = nw;
      if (self.nativescrollingarea) return true; // this isn't my business
      var ret = execScrollWheel(e, false, chk);
      if (ret) self.checkarea = 0;
      return ret;
    };

    this.onmousewheelhr = function(e) {
      if (self.wheelprevented) return;
      if (self.railslocked || !self.railh.scrollable) return true;
      if (self.rail.drag) return self.cancelEvent(e);

      var nw = +(new Date());
      var chk = false;
      if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
        self.nativescrollingarea = self.isScrollable(e);
        chk = true;
      }
      self.checkarea = nw;
      if (self.nativescrollingarea) return true; // this isn't my business
      if (self.railslocked) return self.cancelEvent(e);

      return execScrollWheel(e, true, chk);
    };

    this.stop = function() {
      self.cancelScroll();
      if (self.scrollmon) self.scrollmon.stop();
      self.cursorfreezed = false;
      self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
      self.noticeCursor();
      return self;
    };

    this.getTransitionSpeed = function(dif) {
      var sp = Math.round(self.opt.scrollspeed * 10);
      var ex = Math.min(sp, Math.round((dif / 20) * self.opt.scrollspeed));
      return (ex > 20) ? ex : 0;
    };

    if (!self.opt.smoothscroll) {
      this.doScrollLeft = function(x, spd) { //direct
        var y = self.getScrollTop();
        self.doScrollPos(x, y, spd);
      };
      this.doScrollTop = function(y, spd) { //direct
        var x = self.getScrollLeft();
        self.doScrollPos(x, y, spd);
      };
      this.doScrollPos = function(x, y, spd) { //direct
        var nx = (x > self.page.maxw) ? self.page.maxw : x;
        if (nx < 0) nx = 0;
        var ny = (y > self.page.maxh) ? self.page.maxh : y;
        if (ny < 0) ny = 0;
        self.synched('scroll', function() {
          self.setScrollTop(ny);
          self.setScrollLeft(nx);
        });
      };
      this.cancelScroll = function() {}; // direct
    } else if (self.ishwscroll && cap.hastransition && self.opt.usetransition && !!self.opt.smoothscroll) {
      this.prepareTransition = function(dif, istime) {
        var ex = (istime) ? ((dif > 20) ? dif : 0) : self.getTransitionSpeed(dif);
        var trans = (ex) ? cap.prefixstyle + 'transform ' + ex + 'ms ease-out' : '';
        if (!self.lasttransitionstyle || self.lasttransitionstyle != trans) {
          self.lasttransitionstyle = trans;
          self.doc.css(cap.transitionstyle, trans);
        }
        return ex;
      };

      this.doScrollLeft = function(x, spd) { //trans
        var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
        self.doScrollPos(x, y, spd);
      };

      this.doScrollTop = function(y, spd) { //trans
        var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
        self.doScrollPos(x, y, spd);
      };

      this.doScrollPos = function(x, y, spd) { //trans

        var py = self.getScrollTop();
        var px = self.getScrollLeft();

        if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection      

        if (self.opt.bouncescroll == false) {
          if (y < 0) y = 0;
          else if (y > self.page.maxh) y = self.page.maxh;
          if (x < 0) x = 0;
          else if (x > self.page.maxw) x = self.page.maxw;
        }

        if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false;

        self.newscrolly = y;
        self.newscrollx = x;

        self.newscrollspeed = spd || false;

        if (self.timer) return false;

        self.timer = setTimeout(function() {

          var top = self.getScrollTop();
          var lft = self.getScrollLeft();

          var dst = {};
          dst.x = x - lft;
          dst.y = y - top;
          dst.px = lft;
          dst.py = top;

          var dd = Math.round(Math.sqrt(Math.pow(dst.x, 2) + Math.pow(dst.y, 2)));
          var ms = (self.newscrollspeed && self.newscrollspeed > 1) ? self.newscrollspeed : self.getTransitionSpeed(dd);
          if (self.newscrollspeed && self.newscrollspeed <= 1) ms *= self.newscrollspeed;

          self.prepareTransition(ms, true);

          if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);

          if (ms > 0) {

            if (!self.scrollrunning && self.onscrollstart) {
              var info = {
                "type": "scrollstart",
                "current": {
                  "x": lft,
                  "y": top
                },
                "request": {
                  "x": x,
                  "y": y
                },
                "end": {
                  "x": self.newscrollx,
                  "y": self.newscrolly
                },
                "speed": ms
              };
              self.onscrollstart.call(self, info);
            }

            if (cap.transitionend) {
              if (!self.scrollendtrapped) {
                self.scrollendtrapped = true;
                self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!!
              }
            } else {
              if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
              self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event
            }

            var py = top;
            var px = lft;
            self.timerscroll = {
              bz: new BezierClass(py, self.newscrolly, ms, 0, 0, 0.58, 1),
              bh: new BezierClass(px, self.newscrollx, ms, 0, 0, 0.58, 1)
            };
            if (!self.cursorfreezed) self.timerscroll.tm = setInterval(function() {
              self.showCursor(self.getScrollTop(), self.getScrollLeft());
            }, 60);

          }

          self.synched("doScroll-set", function() {
            self.timer = 0;
            if (self.scrollendtrapped) self.scrollrunning = true;
            self.setScrollTop(self.newscrolly);
            self.setScrollLeft(self.newscrollx);
            if (!self.scrollendtrapped) self.onScrollTransitionEnd();
          });


        }, 50);

      };

      this.cancelScroll = function() {
        if (!self.scrollendtrapped) return true;
        var py = self.getScrollTop();
        var px = self.getScrollLeft();
        self.scrollrunning = false;
        if (!cap.transitionend) clearTimeout(cap.transitionend);
        self.scrollendtrapped = false;
        self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
        self.prepareTransition(0);
        self.setScrollTop(py); // fire event onscroll
        if (self.railh) self.setScrollLeft(px);
        if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
        self.timerscroll = false;

        self.cursorfreezed = false;

        self.showCursor(py, px);
        return self;
      };
      this.onScrollTransitionEnd = function() {
        if (self.scrollendtrapped) self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
        self.scrollendtrapped = false;
        self.prepareTransition(0);
        if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
        self.timerscroll = false;
        var py = self.getScrollTop();
        var px = self.getScrollLeft();
        self.setScrollTop(py); // fire event onscroll        
        if (self.railh) self.setScrollLeft(px); // fire event onscroll left

        self.noticeCursor(false, py, px);

        self.cursorfreezed = false;

        if (py < 0) py = 0;
        else if (py > self.page.maxh) py = self.page.maxh;
        if (px < 0) px = 0;
        else if (px > self.page.maxw) px = self.page.maxw;
        if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, self.opt.snapbackspeed);

        if (self.onscrollend && self.scrollrunning) {
          self.triggerScrollEnd();
        }
        self.scrollrunning = false;

      };

    } else {

      this.doScrollLeft = function(x, spd) { //no-trans
        var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
        self.doScrollPos(x, y, spd);
      };

      this.doScrollTop = function(y, spd) { //no-trans
        var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
        self.doScrollPos(x, y, spd);
      };

      this.doScrollPos = function(x, y, spd) { //no-trans
        var y = (y === undefined || y === false) ? self.getScrollTop(true) : y;

        if ((self.timer) && (self.newscrolly == y) && (self.newscrollx == x)) return true;

        if (self.timer) clearAnimationFrame(self.timer);
        self.timer = 0;

        var py = self.getScrollTop();
        var px = self.getScrollLeft();

        if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection

        self.newscrolly = y;
        self.newscrollx = x;

        if (!self.bouncescroll || !self.rail.visibility) {
          if (self.newscrolly < 0) {
            self.newscrolly = 0;
          } else if (self.newscrolly > self.page.maxh) {
            self.newscrolly = self.page.maxh;
          }
        }
        if (!self.bouncescroll || !self.railh.visibility) {
          if (self.newscrollx < 0) {
            self.newscrollx = 0;
          } else if (self.newscrollx > self.page.maxw) {
            self.newscrollx = self.page.maxw;
          }
        }

        self.dst = {};
        self.dst.x = x - px;
        self.dst.y = y - py;
        self.dst.px = px;
        self.dst.py = py;

        var dst = Math.round(Math.sqrt(Math.pow(self.dst.x, 2) + Math.pow(self.dst.y, 2)));

        self.dst.ax = self.dst.x / dst;
        self.dst.ay = self.dst.y / dst;

        var pa = 0;
        var pe = dst;

        if (self.dst.x == 0) {
          pa = py;
          pe = y;
          self.dst.ay = 1;
          self.dst.py = 0;
        } else if (self.dst.y == 0) {
          pa = px;
          pe = x;
          self.dst.ax = 1;
          self.dst.px = 0;
        }

        var ms = self.getTransitionSpeed(dst);
        if (spd && spd <= 1) ms *= spd;
        if (ms > 0) {
          self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe, ms) : new BezierClass(pa, pe, ms, 0, 1, 0, 1);
        } else {
          self.bzscroll = false;
        }

        if (self.timer) return;

        if ((py == self.page.maxh && y >= self.page.maxh) || (px == self.page.maxw && x >= self.page.maxw)) self.checkContentSize();

        var sync = 1;

        function scrolling() {
          if (self.cancelAnimationFrame) return true;

          self.scrollrunning = true;

          sync = 1 - sync;
          if (sync) return (self.timer = setAnimationFrame(scrolling) || 1);

          var done = 0;
          var sx, sy;

          var sc = sy = self.getScrollTop();
          if (self.dst.ay) {
            sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow() * self.dst.ay) : self.newscrolly;
            var dr = sc - sy;
            if ((dr < 0 && sc < self.newscrolly) || (dr > 0 && sc > self.newscrolly)) sc = self.newscrolly;
            self.setScrollTop(sc);
            if (sc == self.newscrolly) done = 1;
          } else {
            done = 1;
          }

          var scx = sx = self.getScrollLeft();
          if (self.dst.ax) {
            scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow() * self.dst.ax) : self.newscrollx;
            var dr = scx - sx;
            if ((dr < 0 && scx < self.newscrollx) || (dr > 0 && scx > self.newscrollx)) scx = self.newscrollx;
            self.setScrollLeft(scx);
            if (scx == self.newscrollx) done += 1;
          } else {
            done += 1;
          }

          if (done == 2) {
            self.timer = 0;
            self.cursorfreezed = false;
            self.bzscroll = false;
            self.scrollrunning = false;
            if (sc < 0) sc = 0;
            else if (sc > self.page.maxh) sc = Math.max(0,self.page.maxh);
            if (scx < 0) scx = 0;
            else if (scx > self.page.maxw) scx = self.page.maxw;
            if ((scx != self.newscrollx) || (sc != self.newscrolly)) self.doScrollPos(scx, sc);
            else {
              if (self.onscrollend) {
                self.triggerScrollEnd();
              }
            }
          } else {
            self.timer = setAnimationFrame(scrolling) || 1;
          }
        }
        self.cancelAnimationFrame = false;
        self.timer = 1;

        if (self.onscrollstart && !self.scrollrunning) {
          var info = {
            "type": "scrollstart",
            "current": {
              "x": px,
              "y": py
            },
            "request": {
              "x": x,
              "y": y
            },
            "end": {
              "x": self.newscrollx,
              "y": self.newscrolly
            },
            "speed": ms
          };
          self.onscrollstart.call(self, info);
        }

        scrolling();

        if ((py == self.page.maxh && y >= py) || (px == self.page.maxw && x >= px)) self.checkContentSize();

        self.noticeCursor();
      };

      this.cancelScroll = function() {
        if (self.timer) clearAnimationFrame(self.timer);
        self.timer = 0;
        self.bzscroll = false;
        self.scrollrunning = false;
        return self;
      };

    }

    this.doScrollBy = function(stp, relative) {
      var ny = 0;
      if (relative) {
        ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y);
      } else {
        var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true);
        ny = sy - stp;
      }
      if (self.bouncescroll) {
        var haf = Math.round(self.view.h / 2);
        if (ny < -haf) ny = -haf;
        else if (ny > (self.page.maxh + haf)) ny = (self.page.maxh + haf);
      }
      self.cursorfreezed = false;

      var py = self.getScrollTop(true);
      if (ny < 0 && py <= 0) return self.noticeCursor();
      else if (ny > self.page.maxh && py >= self.page.maxh) {
        self.checkContentSize();
        return self.noticeCursor();
      }

      self.doScrollTop(ny);
    };

    this.doScrollLeftBy = function(stp, relative) {
      var nx = 0;
      if (relative) {
        nx = Math.floor((self.scroll.x - stp) * self.scrollratio.x);
      } else {
        var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true);
        nx = sx - stp;
      }
      if (self.bouncescroll) {
        var haf = Math.round(self.view.w / 2);
        if (nx < -haf) nx = -haf;
        else if (nx > (self.page.maxw + haf)) nx = (self.page.maxw + haf);
      }
      self.cursorfreezed = false;

      var px = self.getScrollLeft(true);
      if (nx < 0 && px <= 0) return self.noticeCursor();
      else if (nx > self.page.maxw && px >= self.page.maxw) return self.noticeCursor();

      self.doScrollLeft(nx);
    };

    this.doScrollTo = function(pos, relative) {
      var ny = (relative) ? Math.round(pos * self.scrollratio.y) : pos;
      if (ny < 0) ny = 0;
      else if (ny > self.page.maxh) ny = self.page.maxh;
      self.cursorfreezed = false;
      self.doScrollTop(pos);
    };

    this.checkContentSize = function() {
      var pg = self.getContentSize();
      if ((pg.h != self.page.h) || (pg.w != self.page.w)) self.resize(false, pg);
    };

    self.onscroll = function(e) {
      if (self.rail.drag) return;
      if (!self.cursorfreezed) {
        self.synched('scroll', function() {
          self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
          if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
          self.noticeCursor();
        });
      }
    };
    self.bind(self.docscroll, "scroll", self.onscroll);

    this.doZoomIn = function(e) {
      if (self.zoomactive) return;
      self.zoomactive = true;

      self.zoomrestore = {
        style: {}
      };
      var lst = ['position', 'top', 'left', 'zIndex', 'backgroundColor', 'marginTop', 'marginBottom', 'marginLeft', 'marginRight'];
      var win = self.win[0].style;
      for (var a in lst) {
        var pp = lst[a];
        self.zoomrestore.style[pp] = (win[pp] !== undefined) ? win[pp] : '';
      }

      self.zoomrestore.style.width = self.win.css('width');
      self.zoomrestore.style.height = self.win.css('height');

      self.zoomrestore.padding = {
        w: self.win.outerWidth() - self.win.width(),
        h: self.win.outerHeight() - self.win.height()
      };

      if (cap.isios4) {
        self.zoomrestore.scrollTop = $(window).scrollTop();
        $(window).scrollTop(0);
      }

      self.win.css({
        position: (cap.isios4) ? "absolute" : "fixed",
        top: 0,
        left: 0,
        zIndex: globalmaxzindex + 100,
        margin: 0
      });
      var bkg = self.win.css("backgroundColor");
      if (bkg == "" || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff");
      self.rail.css({
        zIndex: globalmaxzindex + 101
      });
      self.zoom.css({
        zIndex: globalmaxzindex + 102
      });
      self.zoom.css('backgroundPosition', '0px -18px');
      self.resizeZoom();

      if (self.onzoomin) self.onzoomin.call(self);

      return self.cancelEvent(e);
    };

    this.doZoomOut = function(e) {
      if (!self.zoomactive) return;
      self.zoomactive = false;

      self.win.css("margin", "");
      self.win.css(self.zoomrestore.style);

      if (cap.isios4) {
        $(window).scrollTop(self.zoomrestore.scrollTop);
      }

      self.rail.css({
        "z-index": self.zindex
      });
      self.zoom.css({
        "z-index": self.zindex
      });
      self.zoomrestore = false;
      self.zoom.css('backgroundPosition', '0px 0px');
      self.onResize();

      if (self.onzoomout) self.onzoomout.call(self);

      return self.cancelEvent(e);
    };

    this.doZoom = function(e) {
      return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e);
    };

    this.resizeZoom = function() {
      if (!self.zoomactive) return;

      var py = self.getScrollTop(); //preserve scrolling position
      self.win.css({
        width: $(window).width() - self.zoomrestore.padding.w + "px",
        height: $(window).height() - self.zoomrestore.padding.h + "px"
      });
      self.onResize();

      self.setScrollTop(Math.min(self.page.maxh, py));
    };

    this.init();

    $.nicescroll.push(this);

  };

  // Inspired by the work of Kin Blas
  // http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js  


  var ScrollMomentumClass2D = function(nc) {
    var self = this;
    this.nc = nc;

    this.lastx = 0;
    this.lasty = 0;
    this.speedx = 0;
    this.speedy = 0;
    this.lasttime = 0;
    this.steptime = 0;
    this.snapx = false;
    this.snapy = false;
    this.demulx = 0;
    this.demuly = 0;

    this.lastscrollx = -1;
    this.lastscrolly = -1;

    this.chkx = 0;
    this.chky = 0;

    this.timer = 0;

    this.time = function() {
      return +new Date(); //beautifull hack
    };

    this.reset = function(px, py) {
      self.stop();
      var now = self.time();
      self.steptime = 0;
      self.lasttime = now;
      self.speedx = 0;
      self.speedy = 0;
      self.lastx = px;
      self.lasty = py;
      self.lastscrollx = -1;
      self.lastscrolly = -1;
    };

    this.update = function(px, py) {
      var now = self.time();
      self.steptime = now - self.lasttime;
      self.lasttime = now;
      var dy = py - self.lasty;
      var dx = px - self.lastx;
      var sy = self.nc.getScrollTop();
      var sx = self.nc.getScrollLeft();
      var newy = sy + dy;
      var newx = sx + dx;
      self.snapx = (newx < 0) || (newx > self.nc.page.maxw);
      self.snapy = (newy < 0) || (newy > self.nc.page.maxh);
      self.speedx = dx;
      self.speedy = dy;
      self.lastx = px;
      self.lasty = py;
    };

    this.stop = function() {
      self.nc.unsynched("domomentum2d");
      if (self.timer) clearTimeout(self.timer);
      self.timer = 0;
      self.lastscrollx = -1;
      self.lastscrolly = -1;
    };

    this.doSnapy = function(nx, ny) {
      var snap = false;

      if (ny < 0) {
        ny = 0;
        snap = true;
      } else if (ny > self.nc.page.maxh) {
        ny = self.nc.page.maxh;
        snap = true;
      }

      if (nx < 0) {
        nx = 0;
        snap = true;
      } else if (nx > self.nc.page.maxw) {
        nx = self.nc.page.maxw;
        snap = true;
      }

      (snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed): self.nc.triggerScrollEnd();
    };

    this.doMomentum = function(gp) {
      var t = self.time();
      var l = (gp) ? t + gp : self.lasttime;

      var sl = self.nc.getScrollLeft();
      var st = self.nc.getScrollTop();

      var pageh = self.nc.page.maxh;
      var pagew = self.nc.page.maxw;

      self.speedx = (pagew > 0) ? Math.min(60, self.speedx) : 0;
      self.speedy = (pageh > 0) ? Math.min(60, self.speedy) : 0;

      var chk = l && (t - l) <= 60;

      if ((st < 0) || (st > pageh) || (sl < 0) || (sl > pagew)) chk = false;

      var sy = (self.speedy && chk) ? self.speedy : false;
      var sx = (self.speedx && chk) ? self.speedx : false;

      if (sy || sx) {
        var tm = Math.max(16, self.steptime); //timeout granularity

        if (tm > 50) { // do smooth
          var xm = tm / 50;
          self.speedx *= xm;
          self.speedy *= xm;
          tm = 50;
        }

        self.demulxy = 0;

        self.lastscrollx = self.nc.getScrollLeft();
        self.chkx = self.lastscrollx;
        self.lastscrolly = self.nc.getScrollTop();
        self.chky = self.lastscrolly;

        var nx = self.lastscrollx;
        var ny = self.lastscrolly;

        var onscroll = function() {
          var df = ((self.time() - t) > 600) ? 0.04 : 0.02;

          if (self.speedx) {
            nx = Math.floor(self.lastscrollx - (self.speedx * (1 - self.demulxy)));
            self.lastscrollx = nx;
            if ((nx < 0) || (nx > pagew)) df = 0.10;
          }

          if (self.speedy) {
            ny = Math.floor(self.lastscrolly - (self.speedy * (1 - self.demulxy)));
            self.lastscrolly = ny;
            if ((ny < 0) || (ny > pageh)) df = 0.10;
          }

          self.demulxy = Math.min(1, self.demulxy + df);

          self.nc.synched("domomentum2d", function() {

            if (self.speedx) {
              var scx = self.nc.getScrollLeft();
//              if (scx != self.chkx) self.stop();
              self.chkx = nx;
              self.nc.setScrollLeft(nx);
            }

            if (self.speedy) {
              var scy = self.nc.getScrollTop();
//              if (scy != self.chky) self.stop();
              self.chky = ny;
              self.nc.setScrollTop(ny);
            }

            if (!self.timer) {
              self.nc.hideCursor();
              self.doSnapy(nx, ny);
            }

          });

          if (self.demulxy < 1) {
            self.timer = setTimeout(onscroll, tm);
          } else {
            self.stop();
            self.nc.hideCursor();
            self.doSnapy(nx, ny);
          }
        };

        onscroll();

      } else {
        self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop());
      }

    };

  };


  // override jQuery scrollTop

  var _scrollTop = jQuery.fn.scrollTop; // preserve original function

  jQuery.cssHooks.pageYOffset = {
    get: function(elem, computed, extra) {
      var nice = $.data(elem, '__nicescroll') || false;
      return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem);
    },
    set: function(elem, value) {
      var nice = $.data(elem, '__nicescroll') || false;
      (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call(elem, value);
      return this;
    }
  };

  /*  
  $.fx.step["scrollTop"] = function(fx){    
    $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit );
  };
*/

  jQuery.fn.scrollTop = function(value) {
    if (value === undefined) {
      var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
      return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this);
    } else {
      return this.each(function() {
        var nice = $.data(this, '__nicescroll') || false;
        (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call($(this), value);
      });
    }
  };

  // override jQuery scrollLeft

  var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function

  $.cssHooks.pageXOffset = {
    get: function(elem, computed, extra) {
      var nice = $.data(elem, '__nicescroll') || false;
      return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem);
    },
    set: function(elem, value) {
      var nice = $.data(elem, '__nicescroll') || false;
      (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call(elem, value);
      return this;
    }
  };

  /*  
  $.fx.step["scrollLeft"] = function(fx){
    $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit );
  };  
*/

  jQuery.fn.scrollLeft = function(value) {
    if (value === undefined) {
      var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
      return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this);
    } else {
      return this.each(function() {
        var nice = $.data(this, '__nicescroll') || false;
        (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call($(this), value);
      });
    }
  };

  var NiceScrollArray = function(doms) {
    var self = this;
    this.length = 0;
    this.name = "nicescrollarray";

    this.each = function(fn) {
      $.each(self, fn);
      return self;
    };

    this.push = function(nice) {
      self[self.length] = nice;
      self.length++;
    };

    this.eq = function(idx) {
      return self[idx];
    };

    if (doms) {
      for (var a = 0; a < doms.length; a++) {
        var nice = $.data(doms[a], '__nicescroll') || false;
        if (nice) {
          this[this.length] = nice;
          this.length++;
        }
      }
    }

    return this;
  };

  function mplex(el, lst, fn) {
    for (var a = 0; a < lst.length; a++) fn(el, lst[a]);
  }
  mplex(
    NiceScrollArray.prototype, ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'],
    function(e, n) {
      e[n] = function() {
        var args = arguments;
        return this.each(function() {
          this[n].apply(this, args);
        });
      };
    }
  );

  jQuery.fn.getNiceScroll = function(index) {
    if (index === undefined) {
      return new NiceScrollArray(this);
    } else {
      return this[index] && $.data(this[index], '__nicescroll') || false;
    }
  };

  jQuery.expr[':'].nicescroll = function(a) {
    return $.data(a, '__nicescroll') !== undefined;
  };

  $.fn.niceScroll = function(wrapper, opt) {
    if (opt === undefined && typeof wrapper == "object" && !("jquery" in wrapper)) {
      opt = wrapper;
      wrapper = false;
    }
    opt = $.extend({},opt); // cloning
    var ret = new NiceScrollArray();
    if (opt === undefined) opt = {};

    if (wrapper || false) {
      opt.doc = $(wrapper);
      opt.win = $(this);
    }
    var docundef = !("doc" in opt);
    if (!docundef && !("win" in opt)) opt.win = $(this);

    this.each(function() {
      var nice = $(this).data('__nicescroll') || false;
      if (!nice) {
        opt.doc = (docundef) ? $(this) : opt.doc;
        nice = new NiceScrollClass(opt, $(this));
        $(this).data('__nicescroll', nice);
      }
      ret.push(nice);
    });
    return (ret.length == 1) ? ret[0] : ret;
  };

  window.NiceScroll = {
    getjQuery: function() {
      return jQuery;
    }
  };

  if (!$.nicescroll) {
    $.nicescroll = new NiceScrollArray();
    $.nicescroll.options = _globaloptions;
  }

}));

});